C29H23ClN4O2S — CID 123639818
2-[2-[2-(4-amino-3-methanimidoyl-2-methylphenyl)-4-pyridinyl]-7-(4-chlorophenyl)-5-methyl-1,3-benzothiazol-6-yl]acetic acid (PubChem CID 123639818) has the molecular formula C29H23ClN4O2S and a molecular weight of 527.05 g/mol. Its IUPAC name is 2-[2-[2-(4-amino-3-methanimidoyl-2-methylphenyl)-4-pyridinyl]-7-(4-chlorophenyl)-5-methyl-1,3-benzothiazol-6-yl]acetic acid.
| Compound Name | 2-[2-[2-(4-amino-3-methanimidoyl-2-methylphenyl)-4-pyridinyl]-7-(4-chlorophenyl)-5-methyl-1,3-benzothiazol-6-yl]acetic acid |
|---|---|
| PubChem CID | 123639818 |
| Molecular Formula | C29H23ClN4O2S |
| Molecular Weight | 527.05 g/mol |
| Exact Mass | 526.12 |
| IUPAC Name | 2-[2-[2-(4-amino-3-methanimidoyl-2-methylphenyl)-4-pyridinyl]-7-(4-chlorophenyl)-5-methyl-1,3-benzothiazol-6-yl]acetic acid |
| SMILES | [H]/N=C/c1c(N)ccc(-c2cc(-c3nc4cc(C)c(CC(=O)O)c(-c5ccc(Cl)cc5)c4s3)ccn2)c1C |
| InChI | InChI=1S/C29H23ClN4O2S/c1-15-11-25-28(27(21(15)13-26(35)36)17-3-5-19(30)6-4-17)37-29(34-25)18-9-10-33-24(12-18)20-7-8-23(32)22(14-31)16(20)2/h3-12,14,31H,13,32H2,1-2H3,(H,35,36)/b31-14+ |
| InChIKey | ZZJSBNJNTKDDOB-XAZZYMPDSA-N |
| XLogP | 7.17 |
| TPSA | 112.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.05 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|