About 2-methyl-N-propylpenta-1,4-dien-3-imine
2-methyl-N-propylpenta-1,4-dien-3-imine (PubChem CID 123640101) has the molecular formula C9H15N
and a molecular weight of 137.23 g/mol. Its IUPAC name is 2-methyl-N-propylpenta-1,4-dien-3-imine.
Molecular Properties
| Compound Name | 2-methyl-N-propylpenta-1,4-dien-3-imine |
| PubChem CID | 123640101 |
| Molecular Formula | C9H15N |
| Molecular Weight | 137.23 g/mol |
| Exact Mass | 137.12 |
| IUPAC Name | 2-methyl-N-propylpenta-1,4-dien-3-imine |
| SMILES | C=C/C(=N\CCC)C(=C)C |
| InChI | InChI=1S/C9H15N/c1-5-7-10-9(6-2)8(3)4/h6H,2-3,5,7H2,1,4H3/b10-9+ |
| InChIKey | LCFYFISWKIUBDN-MDZDMXLPSA-N |
| XLogP | 2.60 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 137.23 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-N-propylpenta-1,4-dien-3-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-N-propylpenta-1,4-dien-3-imine?
The IUPAC name of 2-methyl-N-propylpenta-1,4-dien-3-imine (CID 123640101) is 2-methyl-N-propylpenta-1,4-dien-3-imine.
What is the SMILES notation for 2-methyl-N-propylpenta-1,4-dien-3-imine?
The canonical SMILES for 2-methyl-N-propylpenta-1,4-dien-3-imine is C=C/C(=N\CCC)C(=C)C.
What is the InChIKey of 2-methyl-N-propylpenta-1,4-dien-3-imine?
The InChIKey is LCFYFISWKIUBDN-MDZDMXLPSA-N. The full InChI is InChI=1S/C9H15N/c1-5-7-10-9(6-2)8(3)4/h6H,2-3,5,7H2,1,4H3/b10-9+.
What are the key properties of 2-methyl-N-propylpenta-1,4-dien-3-imine?
2-methyl-N-propylpenta-1,4-dien-3-imine has a molecular weight of 137.23 g/mol, XLogP of 2.60, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-N-propylpenta-1,4-dien-3-imine is sourced from PubChem (CID 123640101), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).