About 5-methoxy-1-methyl-4,5-dihydroimidazole
5-methoxy-1-methyl-4,5-dihydroimidazole (PubChem CID 123641163) has the molecular formula C5H10N2O
and a molecular weight of 114.15 g/mol. Its IUPAC name is 5-methoxy-1-methyl-4,5-dihydroimidazole.
Molecular Properties
| Compound Name | 5-methoxy-1-methyl-4,5-dihydroimidazole |
| PubChem CID | 123641163 |
| Molecular Formula | C5H10N2O |
| Molecular Weight | 114.15 g/mol |
| Exact Mass | 114.08 |
| IUPAC Name | 5-methoxy-1-methyl-4,5-dihydroimidazole |
| SMILES | COC1CN=CN1C |
| InChI | InChI=1S/C5H10N2O/c1-7-4-6-3-5(7)8-2/h4-5H,3H2,1-2H3 |
| InChIKey | FYHFEWAZBDMIAD-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 114.15 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-methoxy-1-methyl-4,5-dihydroimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methoxy-1-methyl-4,5-dihydroimidazole?
The IUPAC name of 5-methoxy-1-methyl-4,5-dihydroimidazole (CID 123641163) is 5-methoxy-1-methyl-4,5-dihydroimidazole.
What is the SMILES notation for 5-methoxy-1-methyl-4,5-dihydroimidazole?
The canonical SMILES for 5-methoxy-1-methyl-4,5-dihydroimidazole is COC1CN=CN1C.
What is the InChIKey of 5-methoxy-1-methyl-4,5-dihydroimidazole?
The InChIKey is FYHFEWAZBDMIAD-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10N2O/c1-7-4-6-3-5(7)8-2/h4-5H,3H2,1-2H3.
What are the key properties of 5-methoxy-1-methyl-4,5-dihydroimidazole?
5-methoxy-1-methyl-4,5-dihydroimidazole has a molecular weight of 114.15 g/mol, XLogP of -0.07, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methoxy-1-methyl-4,5-dihydroimidazole is sourced from PubChem (CID 123641163), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).