C29H34N4O3 — CID 123641233
3-(1,3-benzodioxol-5-yl)-1-[(2S)-2-[2-[4-(1H-indol-4-yl)piperazin-1-yl]ethyl]piperidin-1-yl]prop-2-en-1-one (PubChem CID 123641233) has the molecular formula C29H34N4O3 and a molecular weight of 486.62 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-yl)-1-[(2S)-2-[2-[4-(1H-indol-4-yl)piperazin-1-yl]ethyl]piperidin-1-yl]prop-2-en-1-one.
| Compound Name | 3-(1,3-benzodioxol-5-yl)-1-[(2S)-2-[2-[4-(1H-indol-4-yl)piperazin-1-yl]ethyl]piperidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 123641233 |
| Molecular Formula | C29H34N4O3 |
| Molecular Weight | 486.62 g/mol |
| Exact Mass | 486.26 |
| IUPAC Name | 3-(1,3-benzodioxol-5-yl)-1-[(2S)-2-[2-[4-(1H-indol-4-yl)piperazin-1-yl]ethyl]piperidin-1-yl]prop-2-en-1-one |
| SMILES | O=C(C=Cc1ccc2c(c1)OCO2)N1CCCC[C@H]1CCN1CCN(c2cccc3[nH]ccc23)CC1 |
| InChI | InChI=1S/C29H34N4O3/c34-29(10-8-22-7-9-27-28(20-22)36-21-35-27)33-14-2-1-4-23(33)12-15-31-16-18-32(19-17-31)26-6-3-5-25-24(26)11-13-30-25/h3,5-11,13,20,23,30H,1-2,4,12,14-19,21H2/t23-/m0/s1 |
| InChIKey | PKKSJTGRUISBHC-QHCPKHFHSA-N |
| XLogP | 4.50 |
| TPSA | 61.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.62 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|