C20H33BO6 — CID 123641384
dipropan-2-yl 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohex-3-ene-1,1-dicarboxylate (PubChem CID 123641384) has the molecular formula C20H33BO6 and a molecular weight of 380.29 g/mol. Its IUPAC name is dipropan-2-yl 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohex-3-ene-1,1-dicarboxylate.
| Compound Name | dipropan-2-yl 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohex-3-ene-1,1-dicarboxylate |
|---|---|
| PubChem CID | 123641384 |
| Molecular Formula | C20H33BO6 |
| Molecular Weight | 380.29 g/mol |
| Exact Mass | 380.24 |
| IUPAC Name | dipropan-2-yl 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohex-3-ene-1,1-dicarboxylate |
| SMILES | CC(C)OC(=O)C1(C(=O)OC(C)C)CC=C(B2OC(C)(C)C(C)(C)O2)CC1 |
| InChI | InChI=1S/C20H33BO6/c1-13(2)24-16(22)20(17(23)25-14(3)4)11-9-15(10-12-20)21-26-18(5,6)19(7,8)27-21/h9,13-14H,10-12H2,1-8H3 |
| InChIKey | HCVVTVCVEJDKIL-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.29 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|