C23H20BF6N7O2 — CID 123641622
7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-N,1-bis[4-(trifluoromethyl)pyrimidin-2-yl]indazol-5-amine (PubChem CID 123641622) has the molecular formula C23H20BF6N7O2 and a molecular weight of 551.26 g/mol. Its IUPAC name is 7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-N,1-bis[4-(trifluoromethyl)pyrimidin-2-yl]indazol-5-amine.
| Compound Name | 7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-N,1-bis[4-(trifluoromethyl)pyrimidin-2-yl]indazol-5-amine |
|---|---|
| PubChem CID | 123641622 |
| Molecular Formula | C23H20BF6N7O2 |
| Molecular Weight | 551.26 g/mol |
| Exact Mass | 551.17 |
| IUPAC Name | 7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-N,1-bis[4-(trifluoromethyl)pyrimidin-2-yl]indazol-5-amine |
| SMILES | CC1(C)OB(c2cc(Nc3nccc(C(F)(F)F)n3)cc3cnn(-c4nccc(C(F)(F)F)n4)c23)OC1(C)C |
| InChI | InChI=1S/C23H20BF6N7O2/c1-20(2)21(3,4)39-24(38-20)14-10-13(34-18-31-7-5-15(35-18)22(25,26)27)9-12-11-33-37(17(12)14)19-32-8-6-16(36-19)23(28,29)30/h5-11H,1-4H3,(H,31,34,35) |
| InChIKey | MVGWTLRVAUEWJU-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 99.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.26 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|