C24H21F7O2 — CID 123641656
5-[difluoro-(4-prop-1-enylcyclohexyl)methoxy]-1,3-difluoro-2-[4-(1,2,2-trifluoroethenoxy)phenyl]benzene (PubChem CID 123641656) has the molecular formula C24H21F7O2 and a molecular weight of 474.42 g/mol. Its IUPAC name is 5-[difluoro-(4-prop-1-enylcyclohexyl)methoxy]-1,3-difluoro-2-[4-(1,2,2-trifluoroethenoxy)phenyl]benzene.
| Compound Name | 5-[difluoro-(4-prop-1-enylcyclohexyl)methoxy]-1,3-difluoro-2-[4-(1,2,2-trifluoroethenoxy)phenyl]benzene |
|---|---|
| PubChem CID | 123641656 |
| Molecular Formula | C24H21F7O2 |
| Molecular Weight | 474.42 g/mol |
| Exact Mass | 474.14 |
| IUPAC Name | 5-[difluoro-(4-prop-1-enylcyclohexyl)methoxy]-1,3-difluoro-2-[4-(1,2,2-trifluoroethenoxy)phenyl]benzene |
| SMILES | CC=CC1CCC(C(F)(F)Oc2cc(F)c(-c3ccc(OC(F)=C(F)F)cc3)c(F)c2)CC1 |
| InChI | InChI=1S/C24H21F7O2/c1-2-3-14-4-8-16(9-5-14)24(30,31)33-18-12-19(25)21(20(26)13-18)15-6-10-17(11-7-15)32-23(29)22(27)28/h2-3,6-7,10-14,16H,4-5,8-9H2,1H3 |
| InChIKey | RBSNGNVXTPDCCC-UHFFFAOYSA-N |
| XLogP | 8.40 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.42 |
| LogP ≤ 5 | 8.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|