C18H17FN3+ — CID 123641933
2,2-diethyl-6-fluoro-3-methylidene-5,7-diaza-1-azoniatetracyclo[6.6.2.04,16.011,15]hexadeca-1(14),4,6,8(16),9,11(15),12-heptaene (PubChem CID 123641933) has the molecular formula C18H17FN3+ and a molecular weight of 294.35 g/mol. Its IUPAC name is 2,2-diethyl-6-fluoro-3-methylidene-5,7-diaza-1-azoniatetracyclo[6.6.2.04,16.011,15]hexadeca-1(14),4,6,8(16),9,11(15),12-heptaene.
| Compound Name | 2,2-diethyl-6-fluoro-3-methylidene-5,7-diaza-1-azoniatetracyclo[6.6.2.04,16.011,15]hexadeca-1(14),4,6,8(16),9,11(15),12-heptaene |
|---|---|
| PubChem CID | 123641933 |
| Molecular Formula | C18H17FN3+ |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.14 |
| IUPAC Name | 2,2-diethyl-6-fluoro-3-methylidene-5,7-diaza-1-azoniatetracyclo[6.6.2.04,16.011,15]hexadeca-1(14),4,6,8(16),9,11(15),12-heptaene |
| SMILES | C=C1c2nc(F)nc3ccc4ccc[n+](c4c23)C1(CC)CC |
| InChI | InChI=1S/C18H17FN3/c1-4-18(5-2)11(3)15-14-13(20-17(19)21-15)9-8-12-7-6-10-22(18)16(12)14/h6-10H,3-5H2,1-2H3/q+1 |
| InChIKey | RGBKCQQWMYNMHM-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 29.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|