C22H22N2O6 — CID 123642023
(3'aR,6'S,9'aR,9'bR)-6',9'a-dimethyl-3-(2-nitrophenyl)spiro[2H-1,2-oxazole-5,3'-3a,4,5,6,6a,9b-hexahydroazuleno[8,7-b]furan]-2',9'-dione (PubChem CID 123642023) has the molecular formula C22H22N2O6 and a molecular weight of 410.43 g/mol. Its IUPAC name is (3'aR,6'S,9'aR,9'bR)-6',9'a-dimethyl-3-(2-nitrophenyl)spiro[2H-1,2-oxazole-5,3'-3a,4,5,6,6a,9b-hexahydroazuleno[8,7-b]furan]-2',9'-dione.
| Compound Name | (3'aR,6'S,9'aR,9'bR)-6',9'a-dimethyl-3-(2-nitrophenyl)spiro[2H-1,2-oxazole-5,3'-3a,4,5,6,6a,9b-hexahydroazuleno[8,7-b]furan]-2',9'-dione |
|---|---|
| PubChem CID | 123642023 |
| Molecular Formula | C22H22N2O6 |
| Molecular Weight | 410.43 g/mol |
| Exact Mass | 410.15 |
| IUPAC Name | (3'aR,6'S,9'aR,9'bR)-6',9'a-dimethyl-3-(2-nitrophenyl)spiro[2H-1,2-oxazole-5,3'-3a,4,5,6,6a,9b-hexahydroazuleno[8,7-b]furan]-2',9'-dione |
| SMILES | C[C@H]1CC[C@@H]2[C@@H](OC(=O)C23C=C(c2ccccc2[N+](=O)[O-])NO3)[C@]2(C)C(=O)C=CC12 |
| InChI | InChI=1S/C22H22N2O6/c1-12-7-8-15-19(21(2)14(12)9-10-18(21)25)29-20(26)22(15)11-16(23-30-22)13-5-3-4-6-17(13)24(27)28/h3-6,9-12,14-15,19,23H,7-8H2,1-2H3/t12-,14?,15+,19+,21-,22?/m0/s1 |
| InChIKey | YDOPYWJQXPOMTQ-VMJBRAIGSA-N |
| XLogP | 2.94 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.43 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|