About 1-(4-ethylhexa-2,4-dien-3-yl)piperazine
1-(4-ethylhexa-2,4-dien-3-yl)piperazine (PubChem CID 123642101) has the molecular formula C12H22N2
and a molecular weight of 194.32 g/mol. Its IUPAC name is 1-(4-ethylhexa-2,4-dien-3-yl)piperazine.
Molecular Properties
| Compound Name | 1-(4-ethylhexa-2,4-dien-3-yl)piperazine |
| PubChem CID | 123642101 |
| Molecular Formula | C12H22N2 |
| Molecular Weight | 194.32 g/mol |
| Exact Mass | 194.18 |
| IUPAC Name | 1-(4-ethylhexa-2,4-dien-3-yl)piperazine |
| SMILES | CC=C(CC)C(=CC)N1CCNCC1 |
| InChI | InChI=1S/C12H22N2/c1-4-11(5-2)12(6-3)14-9-7-13-8-10-14/h4,6,13H,5,7-10H2,1-3H3 |
| InChIKey | VFDHCMOMIAZXHH-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.32 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 1-(4-ethylhexa-2,4-dien-3-yl)piperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-ethylhexa-2,4-dien-3-yl)piperazine?
The IUPAC name of 1-(4-ethylhexa-2,4-dien-3-yl)piperazine (CID 123642101) is 1-(4-ethylhexa-2,4-dien-3-yl)piperazine.
What is the SMILES notation for 1-(4-ethylhexa-2,4-dien-3-yl)piperazine?
The canonical SMILES for 1-(4-ethylhexa-2,4-dien-3-yl)piperazine is CC=C(CC)C(=CC)N1CCNCC1.
What is the InChIKey of 1-(4-ethylhexa-2,4-dien-3-yl)piperazine?
The InChIKey is VFDHCMOMIAZXHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22N2/c1-4-11(5-2)12(6-3)14-9-7-13-8-10-14/h4,6,13H,5,7-10H2,1-3H3.
What are the key properties of 1-(4-ethylhexa-2,4-dien-3-yl)piperazine?
1-(4-ethylhexa-2,4-dien-3-yl)piperazine has a molecular weight of 194.32 g/mol, XLogP of 2.15, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-ethylhexa-2,4-dien-3-yl)piperazine is sourced from PubChem (CID 123642101), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).