C17H24O2 — CID 123642105
2,2,4,4,6,6-hexamethyl-1H-3-benzoxocin-5-one (PubChem CID 123642105) has the molecular formula C17H24O2 and a molecular weight of 260.38 g/mol. Its IUPAC name is 2,2,4,4,6,6-hexamethyl-1H-3-benzoxocin-5-one.
| Compound Name | 2,2,4,4,6,6-hexamethyl-1H-3-benzoxocin-5-one |
|---|---|
| PubChem CID | 123642105 |
| Molecular Formula | C17H24O2 |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.18 |
| IUPAC Name | 2,2,4,4,6,6-hexamethyl-1H-3-benzoxocin-5-one |
| SMILES | CC1(C)Cc2ccccc2C(C)(C)C(=O)C(C)(C)O1 |
| InChI | InChI=1S/C17H24O2/c1-15(2)11-12-9-7-8-10-13(12)16(3,4)14(18)17(5,6)19-15/h7-10H,11H2,1-6H3 |
| InChIKey | UDUSOQPASJSFHM-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |