C18H30N7O5P — CID 123642304
3-[[[2-(2,5-dioxopyrrol-1-yl)ethyl-methylamino]-[methyl-[2-(5-oxo-2H-pyrrol-1-yl)ethyl]amino]phosphoryl]-methylamino]propanehydrazide (PubChem CID 123642304) has the molecular formula C18H30N7O5P and a molecular weight of 455.46 g/mol. Its IUPAC name is 3-[[[2-(2,5-dioxopyrrol-1-yl)ethyl-methylamino]-[methyl-[2-(5-oxo-2H-pyrrol-1-yl)ethyl]amino]phosphoryl]-methylamino]propanehydrazide.
| Compound Name | 3-[[[2-(2,5-dioxopyrrol-1-yl)ethyl-methylamino]-[methyl-[2-(5-oxo-2H-pyrrol-1-yl)ethyl]amino]phosphoryl]-methylamino]propanehydrazide |
|---|---|
| PubChem CID | 123642304 |
| Molecular Formula | C18H30N7O5P |
| Molecular Weight | 455.46 g/mol |
| Exact Mass | 455.20 |
| IUPAC Name | 3-[[[2-(2,5-dioxopyrrol-1-yl)ethyl-methylamino]-[methyl-[2-(5-oxo-2H-pyrrol-1-yl)ethyl]amino]phosphoryl]-methylamino]propanehydrazide |
| SMILES | CN(CCC(=O)NN)P(=O)(N(C)CCN1CC=CC1=O)N(C)CCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C18H30N7O5P/c1-21(10-8-15(26)20-19)31(30,22(2)11-13-24-9-4-5-16(24)27)23(3)12-14-25-17(28)6-7-18(25)29/h4-7H,8-14,19H2,1-3H3,(H,20,26) |
| InChIKey | IFXQEXZCVSOINL-UHFFFAOYSA-N |
| XLogP | -1.41 |
| TPSA | 139.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.46 |
| LogP ≤ 5 | -1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|