About 4-methyl-5-nitroso-1-propan-2-ylcyclohex-2-ene-1,4-diol
4-methyl-5-nitroso-1-propan-2-ylcyclohex-2-ene-1,4-diol (PubChem CID 123642464) has the molecular formula C10H17NO3
and a molecular weight of 199.25 g/mol. Its IUPAC name is 4-methyl-5-nitroso-1-propan-2-ylcyclohex-2-ene-1,4-diol.
Molecular Properties
| Compound Name | 4-methyl-5-nitroso-1-propan-2-ylcyclohex-2-ene-1,4-diol |
| PubChem CID | 123642464 |
| Molecular Formula | C10H17NO3 |
| Molecular Weight | 199.25 g/mol |
| Exact Mass | 199.12 |
| IUPAC Name | 4-methyl-5-nitroso-1-propan-2-ylcyclohex-2-ene-1,4-diol |
| SMILES | CC(C)C1(O)C=CC(C)(O)C(N=O)C1 |
| InChI | InChI=1S/C10H17NO3/c1-7(2)10(13)5-4-9(3,12)8(6-10)11-14/h4-5,7-8,12-13H,6H2,1-3H3 |
| InChIKey | ALMFDCHZCBBWHX-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 69.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.25 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-methyl-5-nitroso-1-propan-2-ylcyclohex-2-ene-1,4-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-5-nitroso-1-propan-2-ylcyclohex-2-ene-1,4-diol?
The IUPAC name of 4-methyl-5-nitroso-1-propan-2-ylcyclohex-2-ene-1,4-diol (CID 123642464) is 4-methyl-5-nitroso-1-propan-2-ylcyclohex-2-ene-1,4-diol.
What is the SMILES notation for 4-methyl-5-nitroso-1-propan-2-ylcyclohex-2-ene-1,4-diol?
The canonical SMILES for 4-methyl-5-nitroso-1-propan-2-ylcyclohex-2-ene-1,4-diol is CC(C)C1(O)C=CC(C)(O)C(N=O)C1.
What is the InChIKey of 4-methyl-5-nitroso-1-propan-2-ylcyclohex-2-ene-1,4-diol?
The InChIKey is ALMFDCHZCBBWHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17NO3/c1-7(2)10(13)5-4-9(3,12)8(6-10)11-14/h4-5,7-8,12-13H,6H2,1-3H3.
What are the key properties of 4-methyl-5-nitroso-1-propan-2-ylcyclohex-2-ene-1,4-diol?
4-methyl-5-nitroso-1-propan-2-ylcyclohex-2-ene-1,4-diol has a molecular weight of 199.25 g/mol, XLogP of 1.22, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-5-nitroso-1-propan-2-ylcyclohex-2-ene-1,4-diol is sourced from PubChem (CID 123642464), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).