C18H27F6N2O7S2- — CID 123642783
1-[4-(1,1,2,2,3,3-hexafluoro-3-methanidylsulfonylpropyl)sulfonylpiperazin-1-yl]-4-hydroxy-6,6-dimethyloctane-1,5-dione (PubChem CID 123642783) has the molecular formula C18H27F6N2O7S2- and a molecular weight of 561.54 g/mol. Its IUPAC name is 1-[4-(1,1,2,2,3,3-hexafluoro-3-methanidylsulfonylpropyl)sulfonylpiperazin-1-yl]-4-hydroxy-6,6-dimethyloctane-1,5-dione.
| Compound Name | 1-[4-(1,1,2,2,3,3-hexafluoro-3-methanidylsulfonylpropyl)sulfonylpiperazin-1-yl]-4-hydroxy-6,6-dimethyloctane-1,5-dione |
|---|---|
| PubChem CID | 123642783 |
| Molecular Formula | C18H27F6N2O7S2- |
| Molecular Weight | 561.54 g/mol |
| Exact Mass | 561.12 |
| IUPAC Name | 1-[4-(1,1,2,2,3,3-hexafluoro-3-methanidylsulfonylpropyl)sulfonylpiperazin-1-yl]-4-hydroxy-6,6-dimethyloctane-1,5-dione |
| SMILES | [CH2-]S(=O)(=O)C(F)(F)C(F)(F)C(F)(F)S(=O)(=O)N1CCN(C(=O)CCC(O)C(=O)C(C)(C)CC)CC1 |
| InChI | InChI=1S/C18H27F6N2O7S2/c1-5-15(2,3)14(29)12(27)6-7-13(28)25-8-10-26(11-9-25)35(32,33)18(23,24)16(19,20)17(21,22)34(4,30)31/h12,27H,4-11H2,1-3H3/q-1 |
| InChIKey | CMNIGQMVTYQOEZ-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 129.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.54 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|