About (6-fluoro-2,3-dimethylocta-4,6-dien-4-yl)-methylidyneazanium
(6-fluoro-2,3-dimethylocta-4,6-dien-4-yl)-methylidyneazanium (PubChem CID 123643638) has the molecular formula C11H17FN+
and a molecular weight of 182.26 g/mol. Its IUPAC name is (6-fluoro-2,3-dimethylocta-4,6-dien-4-yl)-methylidyneazanium.
Molecular Properties
| Compound Name | (6-fluoro-2,3-dimethylocta-4,6-dien-4-yl)-methylidyneazanium |
| PubChem CID | 123643638 |
| Molecular Formula | C11H17FN+ |
| Molecular Weight | 182.26 g/mol |
| Exact Mass | 182.13 |
| IUPAC Name | (6-fluoro-2,3-dimethylocta-4,6-dien-4-yl)-methylidyneazanium |
| SMILES | C#[N+]C(=CC(F)=CC)C(C)C(C)C |
| InChI | InChI=1S/C11H17FN/c1-6-10(12)7-11(13-5)9(4)8(2)3/h5-9H,1-4H3/q+1 |
| InChIKey | QCEXHXGBFHJWJN-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 4.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.26 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (6-fluoro-2,3-dimethylocta-4,6-dien-4-yl)-methylidyneazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-fluoro-2,3-dimethylocta-4,6-dien-4-yl)-methylidyneazanium?
The IUPAC name of (6-fluoro-2,3-dimethylocta-4,6-dien-4-yl)-methylidyneazanium (CID 123643638) is (6-fluoro-2,3-dimethylocta-4,6-dien-4-yl)-methylidyneazanium.
What is the SMILES notation for (6-fluoro-2,3-dimethylocta-4,6-dien-4-yl)-methylidyneazanium?
The canonical SMILES for (6-fluoro-2,3-dimethylocta-4,6-dien-4-yl)-methylidyneazanium is C#[N+]C(=CC(F)=CC)C(C)C(C)C.
What is the InChIKey of (6-fluoro-2,3-dimethylocta-4,6-dien-4-yl)-methylidyneazanium?
The InChIKey is QCEXHXGBFHJWJN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17FN/c1-6-10(12)7-11(13-5)9(4)8(2)3/h5-9H,1-4H3/q+1.
What are the key properties of (6-fluoro-2,3-dimethylocta-4,6-dien-4-yl)-methylidyneazanium?
(6-fluoro-2,3-dimethylocta-4,6-dien-4-yl)-methylidyneazanium has a molecular weight of 182.26 g/mol, XLogP of 4.00, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (6-fluoro-2,3-dimethylocta-4,6-dien-4-yl)-methylidyneazanium is sourced from PubChem (CID 123643638), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).