About (4Z)-octa-1,4,6-trien-3-imine
(4Z)-octa-1,4,6-trien-3-imine (PubChem CID 123643929) has the molecular formula C8H11N
and a molecular weight of 121.18 g/mol. Its IUPAC name is (4Z)-octa-1,4,6-trien-3-imine.
Molecular Properties
| Compound Name | (4Z)-octa-1,4,6-trien-3-imine |
| PubChem CID | 123643929 |
| Molecular Formula | C8H11N |
| Molecular Weight | 121.18 g/mol |
| Exact Mass | 121.09 |
| IUPAC Name | (4Z)-octa-1,4,6-trien-3-imine |
| SMILES | [H]/N=C(C=C)/C=C\C=CC |
| InChI | InChI=1S/C8H11N/c1-3-5-6-7-8(9)4-2/h3-7,9H,2H2,1H3/b5-3?,7-6-,9-8+ |
| InChIKey | XZGCAGBKUSMFTO-JZNHXFEKSA-N |
| XLogP | 2.32 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 121.18 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (4Z)-octa-1,4,6-trien-3-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4Z)-octa-1,4,6-trien-3-imine?
The IUPAC name of (4Z)-octa-1,4,6-trien-3-imine (CID 123643929) is (4Z)-octa-1,4,6-trien-3-imine.
What is the SMILES notation for (4Z)-octa-1,4,6-trien-3-imine?
The canonical SMILES for (4Z)-octa-1,4,6-trien-3-imine is [H]/N=C(C=C)/C=C\C=CC.
What is the InChIKey of (4Z)-octa-1,4,6-trien-3-imine?
The InChIKey is XZGCAGBKUSMFTO-JZNHXFEKSA-N. The full InChI is InChI=1S/C8H11N/c1-3-5-6-7-8(9)4-2/h3-7,9H,2H2,1H3/b5-3?,7-6-,9-8+.
What are the key properties of (4Z)-octa-1,4,6-trien-3-imine?
(4Z)-octa-1,4,6-trien-3-imine has a molecular weight of 121.18 g/mol, XLogP of 2.32, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (4Z)-octa-1,4,6-trien-3-imine is sourced from PubChem (CID 123643929), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).