About methanamine;1,4,7-trioxaspiro[4.4]nonane
methanamine;1,4,7-trioxaspiro[4.4]nonane (PubChem CID 123644073) has the molecular formula C7H15NO3
and a molecular weight of 161.20 g/mol. Its IUPAC name is methanamine;1,4,7-trioxaspiro[4.4]nonane.
Molecular Properties
| Compound Name | methanamine;1,4,7-trioxaspiro[4.4]nonane |
| PubChem CID | 123644073 |
| Molecular Formula | C7H15NO3 |
| Molecular Weight | 161.20 g/mol |
| Exact Mass | 161.11 |
| IUPAC Name | methanamine;1,4,7-trioxaspiro[4.4]nonane |
| SMILES | C1CC2(CO1)OCCO2.CN |
| InChI | InChI=1S/C6H10O3.CH5N/c1-2-7-5-6(1)8-3-4-9-6;1-2/h1-5H2;2H2,1H3 |
| InChIKey | QKKOTPQRSHUGTI-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.20 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methanamine;1,4,7-trioxaspiro[4.4]nonane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanamine;1,4,7-trioxaspiro[4.4]nonane?
The IUPAC name of methanamine;1,4,7-trioxaspiro[4.4]nonane (CID 123644073) is methanamine;1,4,7-trioxaspiro[4.4]nonane.
What is the SMILES notation for methanamine;1,4,7-trioxaspiro[4.4]nonane?
The canonical SMILES for methanamine;1,4,7-trioxaspiro[4.4]nonane is C1CC2(CO1)OCCO2.CN.
What is the InChIKey of methanamine;1,4,7-trioxaspiro[4.4]nonane?
The InChIKey is QKKOTPQRSHUGTI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10O3.CH5N/c1-2-7-5-6(1)8-3-4-9-6;1-2/h1-5H2;2H2,1H3.
What are the key properties of methanamine;1,4,7-trioxaspiro[4.4]nonane?
methanamine;1,4,7-trioxaspiro[4.4]nonane has a molecular weight of 161.20 g/mol, XLogP of -0.28, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methanamine;1,4,7-trioxaspiro[4.4]nonane is sourced from PubChem (CID 123644073), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).