C16H13F3N6O2 — CID 123644101
4-[3-[(6-aminopyrazolo[3,4-d]pyrimidin-1-yl)methyl]-2,4,5-trifluorophenyl]morpholin-3-one (PubChem CID 123644101) has the molecular formula C16H13F3N6O2 and a molecular weight of 378.31 g/mol. Its IUPAC name is 4-[3-[(6-aminopyrazolo[3,4-d]pyrimidin-1-yl)methyl]-2,4,5-trifluorophenyl]morpholin-3-one.
| Compound Name | 4-[3-[(6-aminopyrazolo[3,4-d]pyrimidin-1-yl)methyl]-2,4,5-trifluorophenyl]morpholin-3-one |
|---|---|
| PubChem CID | 123644101 |
| Molecular Formula | C16H13F3N6O2 |
| Molecular Weight | 378.31 g/mol |
| Exact Mass | 378.11 |
| IUPAC Name | 4-[3-[(6-aminopyrazolo[3,4-d]pyrimidin-1-yl)methyl]-2,4,5-trifluorophenyl]morpholin-3-one |
| SMILES | Nc1ncc2cnn(Cc3c(F)c(F)cc(N4CCOCC4=O)c3F)c2n1 |
| InChI | InChI=1S/C16H13F3N6O2/c17-10-3-11(24-1-2-27-7-12(24)26)14(19)9(13(10)18)6-25-15-8(5-22-25)4-21-16(20)23-15/h3-5H,1-2,6-7H2,(H2,20,21,23) |
| InChIKey | QHWBJQMNZZPILF-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 99.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.31 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|