About N-(1,1,1-trifluoro-2-methylpropan-2-yl)pyrrolidine-1-carboxamide
N-(1,1,1-trifluoro-2-methylpropan-2-yl)pyrrolidine-1-carboxamide (PubChem CID 123644110) has the molecular formula C9H15F3N2O
and a molecular weight of 224.23 g/mol. Its IUPAC name is N-(1,1,1-trifluoro-2-methylpropan-2-yl)pyrrolidine-1-carboxamide.
Molecular Properties
| Compound Name | N-(1,1,1-trifluoro-2-methylpropan-2-yl)pyrrolidine-1-carboxamide |
| PubChem CID | 123644110 |
| Molecular Formula | C9H15F3N2O |
| Molecular Weight | 224.23 g/mol |
| Exact Mass | 224.11 |
| IUPAC Name | N-(1,1,1-trifluoro-2-methylpropan-2-yl)pyrrolidine-1-carboxamide |
| SMILES | CC(C)(NC(=O)N1CCCC1)C(F)(F)F |
| InChI | InChI=1S/C9H15F3N2O/c1-8(2,9(10,11)12)13-7(15)14-5-3-4-6-14/h3-6H2,1-2H3,(H,13,15) |
| InChIKey | OFGYUBCSBOKXTI-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.23 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-(1,1,1-trifluoro-2-methylpropan-2-yl)pyrrolidine-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1,1,1-trifluoro-2-methylpropan-2-yl)pyrrolidine-1-carboxamide?
The IUPAC name of N-(1,1,1-trifluoro-2-methylpropan-2-yl)pyrrolidine-1-carboxamide (CID 123644110) is N-(1,1,1-trifluoro-2-methylpropan-2-yl)pyrrolidine-1-carboxamide.
What is the SMILES notation for N-(1,1,1-trifluoro-2-methylpropan-2-yl)pyrrolidine-1-carboxamide?
The canonical SMILES for N-(1,1,1-trifluoro-2-methylpropan-2-yl)pyrrolidine-1-carboxamide is CC(C)(NC(=O)N1CCCC1)C(F)(F)F.
What is the InChIKey of N-(1,1,1-trifluoro-2-methylpropan-2-yl)pyrrolidine-1-carboxamide?
The InChIKey is OFGYUBCSBOKXTI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15F3N2O/c1-8(2,9(10,11)12)13-7(15)14-5-3-4-6-14/h3-6H2,1-2H3,(H,13,15).
What are the key properties of N-(1,1,1-trifluoro-2-methylpropan-2-yl)pyrrolidine-1-carboxamide?
N-(1,1,1-trifluoro-2-methylpropan-2-yl)pyrrolidine-1-carboxamide has a molecular weight of 224.23 g/mol, XLogP of 2.13, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1,1,1-trifluoro-2-methylpropan-2-yl)pyrrolidine-1-carboxamide is sourced from PubChem (CID 123644110), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).