C20H22F3N3O5 — CID 123645390
2-[[2,4-dioxo-1-[[6-(trifluoromethyl)-3-pyridinyl]methyl]-1-azaspiro[5.5]undecane-3-carbonyl]amino]acetic acid (PubChem CID 123645390) has the molecular formula C20H22F3N3O5 and a molecular weight of 441.41 g/mol. Its IUPAC name is 2-[[2,4-dioxo-1-[[6-(trifluoromethyl)-3-pyridinyl]methyl]-1-azaspiro[5.5]undecane-3-carbonyl]amino]acetic acid.
| Compound Name | 2-[[2,4-dioxo-1-[[6-(trifluoromethyl)-3-pyridinyl]methyl]-1-azaspiro[5.5]undecane-3-carbonyl]amino]acetic acid |
|---|---|
| PubChem CID | 123645390 |
| Molecular Formula | C20H22F3N3O5 |
| Molecular Weight | 441.41 g/mol |
| Exact Mass | 441.15 |
| IUPAC Name | 2-[[2,4-dioxo-1-[[6-(trifluoromethyl)-3-pyridinyl]methyl]-1-azaspiro[5.5]undecane-3-carbonyl]amino]acetic acid |
| SMILES | O=C(O)CNC(=O)C1C(=O)CC2(CCCCC2)N(Cc2ccc(C(F)(F)F)nc2)C1=O |
| InChI | InChI=1S/C20H22F3N3O5/c21-20(22,23)14-5-4-12(9-24-14)11-26-18(31)16(17(30)25-10-15(28)29)13(27)8-19(26)6-2-1-3-7-19/h4-5,9,16H,1-3,6-8,10-11H2,(H,25,30)(H,28,29) |
| InChIKey | GJPZVAMBMHTCPA-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 116.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.41 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|