C26H36N4O2S+2 — CID 123645655
2-[4-[2-[1-[4-(1,3-dimethylimidazol-1-ium-2-yl)sulfanylbutyl]pyridin-1-ium-2-yl]ethenyl]-N-(2-hydroxyethyl)anilino]ethanol (PubChem CID 123645655) has the molecular formula C26H36N4O2S+2 and a molecular weight of 468.67 g/mol. Its IUPAC name is 2-[4-[2-[1-[4-(1,3-dimethylimidazol-1-ium-2-yl)sulfanylbutyl]pyridin-1-ium-2-yl]ethenyl]-N-(2-hydroxyethyl)anilino]ethanol.
| Compound Name | 2-[4-[2-[1-[4-(1,3-dimethylimidazol-1-ium-2-yl)sulfanylbutyl]pyridin-1-ium-2-yl]ethenyl]-N-(2-hydroxyethyl)anilino]ethanol |
|---|---|
| PubChem CID | 123645655 |
| Molecular Formula | C26H36N4O2S+2 |
| Molecular Weight | 468.67 g/mol |
| Exact Mass | 468.25 |
| IUPAC Name | 2-[4-[2-[1-[4-(1,3-dimethylimidazol-1-ium-2-yl)sulfanylbutyl]pyridin-1-ium-2-yl]ethenyl]-N-(2-hydroxyethyl)anilino]ethanol |
| SMILES | Cn1cc[n+](C)c1SCCCC[n+]1ccccc1C=Cc1ccc(N(CCO)CCO)cc1 |
| InChI | InChI=1S/C26H36N4O2S/c1-27-16-17-28(2)26(27)33-22-6-5-15-29-14-4-3-7-24(29)11-8-23-9-12-25(13-10-23)30(18-20-31)19-21-32/h3-4,7-14,16-17,31-32H,5-6,15,18-22H2,1-2H3/q+2 |
| InChIKey | SDUXTXUZYSYIJA-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 56.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.67 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|