About N-(4-cyanophenyl)-N-[(5,6-dicyano-3-methylpyrazin-2-yl)methyl]acetamide
N-(4-cyanophenyl)-N-[(5,6-dicyano-3-methylpyrazin-2-yl)methyl]acetamide (PubChem CID 1236462) has the molecular formula C17H12N6O
and a molecular weight of 316.32 g/mol. Its IUPAC name is N-(4-cyanophenyl)-N-[(5,6-dicyano-3-methylpyrazin-2-yl)methyl]acetamide.
Molecular Properties
| Compound Name | N-(4-cyanophenyl)-N-[(5,6-dicyano-3-methylpyrazin-2-yl)methyl]acetamide |
| PubChem CID | 1236462 |
| Molecular Formula | C17H12N6O |
| Molecular Weight | 316.32 g/mol |
| Exact Mass | 316.11 |
| IUPAC Name | N-(4-cyanophenyl)-N-[(5,6-dicyano-3-methylpyrazin-2-yl)methyl]acetamide |
| SMILES | CC(=O)N(Cc1nc(C#N)c(C#N)nc1C)c1ccc(C#N)cc1 |
| InChI | InChI=1S/C17H12N6O/c1-11-17(22-16(9-20)15(8-19)21-11)10-23(12(2)24)14-5-3-13(7-18)4-6-14/h3-6H,10H2,1-2H3 |
| InChIKey | XZOLOPNNGGOUHS-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 117.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.32 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-(4-cyanophenyl)-N-[(5,6-dicyano-3-methylpyrazin-2-yl)methyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-cyanophenyl)-N-[(5,6-dicyano-3-methylpyrazin-2-yl)methyl]acetamide?
The IUPAC name of N-(4-cyanophenyl)-N-[(5,6-dicyano-3-methylpyrazin-2-yl)methyl]acetamide (CID 1236462) is N-(4-cyanophenyl)-N-[(5,6-dicyano-3-methylpyrazin-2-yl)methyl]acetamide.
What is the SMILES notation for N-(4-cyanophenyl)-N-[(5,6-dicyano-3-methylpyrazin-2-yl)methyl]acetamide?
The canonical SMILES for N-(4-cyanophenyl)-N-[(5,6-dicyano-3-methylpyrazin-2-yl)methyl]acetamide is CC(=O)N(Cc1nc(C#N)c(C#N)nc1C)c1ccc(C#N)cc1.
What is the InChIKey of N-(4-cyanophenyl)-N-[(5,6-dicyano-3-methylpyrazin-2-yl)methyl]acetamide?
The InChIKey is XZOLOPNNGGOUHS-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H12N6O/c1-11-17(22-16(9-20)15(8-19)21-11)10-23(12(2)24)14-5-3-13(7-18)4-6-14/h3-6H,10H2,1-2H3.
What are the key properties of N-(4-cyanophenyl)-N-[(5,6-dicyano-3-methylpyrazin-2-yl)methyl]acetamide?
N-(4-cyanophenyl)-N-[(5,6-dicyano-3-methylpyrazin-2-yl)methyl]acetamide has a molecular weight of 316.32 g/mol, XLogP of 1.95, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-cyanophenyl)-N-[(5,6-dicyano-3-methylpyrazin-2-yl)methyl]acetamide is sourced from PubChem (CID 1236462), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).