C18H22FNO3S — CID 123646342
3-fluoro-1-(4-methylsulfonylphenyl)-2-(1-phenylethylamino)propan-1-ol (PubChem CID 123646342) has the molecular formula C18H22FNO3S and a molecular weight of 351.44 g/mol. Its IUPAC name is 3-fluoro-1-(4-methylsulfonylphenyl)-2-(1-phenylethylamino)propan-1-ol.
| Compound Name | 3-fluoro-1-(4-methylsulfonylphenyl)-2-(1-phenylethylamino)propan-1-ol |
|---|---|
| PubChem CID | 123646342 |
| Molecular Formula | C18H22FNO3S |
| Molecular Weight | 351.44 g/mol |
| Exact Mass | 351.13 |
| IUPAC Name | 3-fluoro-1-(4-methylsulfonylphenyl)-2-(1-phenylethylamino)propan-1-ol |
| SMILES | CC(NC(CF)C(O)c1ccc(S(C)(=O)=O)cc1)c1ccccc1 |
| InChI | InChI=1S/C18H22FNO3S/c1-13(14-6-4-3-5-7-14)20-17(12-19)18(21)15-8-10-16(11-9-15)24(2,22)23/h3-11,13,17-18,20-21H,12H2,1-2H3 |
| InChIKey | CYZQLYMSOASJLK-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.44 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |