C26H46F2N8O2 — CID 123646767
3,3-diamino-2-(1-cyclohexyl-5-fluoro-1,3-diazinan-2-yl)-N-[5-fluoro-4-(6-oxo-3,4,7,8,9,9a-hexahydro-1H-pyrido[1,2-a]pyrazin-2-yl)piperidin-3-yl]propanamide (PubChem CID 123646767) has the molecular formula C26H46F2N8O2 and a molecular weight of 540.70 g/mol. Its IUPAC name is 3,3-diamino-2-(1-cyclohexyl-5-fluoro-1,3-diazinan-2-yl)-N-[5-fluoro-4-(6-oxo-3,4,7,8,9,9a-hexahydro-1H-pyrido[1,2-a]pyrazin-2-yl)piperidin-3-yl]propanamide.
| Compound Name | 3,3-diamino-2-(1-cyclohexyl-5-fluoro-1,3-diazinan-2-yl)-N-[5-fluoro-4-(6-oxo-3,4,7,8,9,9a-hexahydro-1H-pyrido[1,2-a]pyrazin-2-yl)piperidin-3-yl]propanamide |
|---|---|
| PubChem CID | 123646767 |
| Molecular Formula | C26H46F2N8O2 |
| Molecular Weight | 540.70 g/mol |
| Exact Mass | 540.37 |
| IUPAC Name | 3,3-diamino-2-(1-cyclohexyl-5-fluoro-1,3-diazinan-2-yl)-N-[5-fluoro-4-(6-oxo-3,4,7,8,9,9a-hexahydro-1H-pyrido[1,2-a]pyrazin-2-yl)piperidin-3-yl]propanamide |
| SMILES | NC(N)C(C(=O)NC1CNCC(F)C1N1CCN2C(=O)CCCC2C1)C1NCC(F)CN1C1CCCCC1 |
| InChI | InChI=1S/C26H46F2N8O2/c27-16-11-32-25(36(14-16)17-5-2-1-3-6-17)22(24(29)30)26(38)33-20-13-31-12-19(28)23(20)34-9-10-35-18(15-34)7-4-8-21(35)37/h16-20,22-25,31-32H,1-15,29-30H2,(H,33,38) |
| InChIKey | PWXKVXZZOLVIFP-UHFFFAOYSA-N |
| XLogP | -0.76 |
| TPSA | 131.99 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.70 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|