C28H29N7O4 — CID 123647266
4-[8-amino-3-[(2S)-1-(4-methoxybut-2-enoyl)pyrrolidin-2-yl]imidazo[1,5-a]pyrazin-1-yl]-2-methoxy-N-pyridin-2-ylbenzamide (PubChem CID 123647266) has the molecular formula C28H29N7O4 and a molecular weight of 527.59 g/mol. Its IUPAC name is 4-[8-amino-3-[(2S)-1-(4-methoxybut-2-enoyl)pyrrolidin-2-yl]imidazo[1,5-a]pyrazin-1-yl]-2-methoxy-N-pyridin-2-ylbenzamide.
| Compound Name | 4-[8-amino-3-[(2S)-1-(4-methoxybut-2-enoyl)pyrrolidin-2-yl]imidazo[1,5-a]pyrazin-1-yl]-2-methoxy-N-pyridin-2-ylbenzamide |
|---|---|
| PubChem CID | 123647266 |
| Molecular Formula | C28H29N7O4 |
| Molecular Weight | 527.59 g/mol |
| Exact Mass | 527.23 |
| IUPAC Name | 4-[8-amino-3-[(2S)-1-(4-methoxybut-2-enoyl)pyrrolidin-2-yl]imidazo[1,5-a]pyrazin-1-yl]-2-methoxy-N-pyridin-2-ylbenzamide |
| SMILES | COCC=CC(=O)N1CCC[C@H]1c1nc(-c2ccc(C(=O)Nc3ccccn3)c(OC)c2)c2c(N)nccn12 |
| InChI | InChI=1S/C28H29N7O4/c1-38-16-6-9-23(36)34-14-5-7-20(34)27-33-24(25-26(29)31-13-15-35(25)27)18-10-11-19(21(17-18)39-2)28(37)32-22-8-3-4-12-30-22/h3-4,6,8-13,15,17,20H,5,7,14,16H2,1-2H3,(H2,29,31)(H,30,32,37)/t20-/m0/s1 |
| InChIKey | RXTUBIVBGQUPLX-FQEVSTJZSA-N |
| XLogP | 3.50 |
| TPSA | 136.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.59 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|