C34H45ClF2N2O3 — CID 123647488
2-[[4-[2-[4-chloro-3-(1,1-difluoroethyl)cyclohexa-1,3-dien-1-yl]-2-oxoethyl]cycloheptyl]methyl]-N-(2-methoxyethyl)-3,7-dimethyl-3,4-dihydro-2-benzazepine-8-carboxamide (PubChem CID 123647488) has the molecular formula C34H45ClF2N2O3 and a molecular weight of 603.19 g/mol. Its IUPAC name is 2-[[4-[2-[4-chloro-3-(1,1-difluoroethyl)cyclohexa-1,3-dien-1-yl]-2-oxoethyl]cycloheptyl]methyl]-N-(2-methoxyethyl)-3,7-dimethyl-3,4-dihydro-2-benzazepine-8-carboxamide.
| Compound Name | 2-[[4-[2-[4-chloro-3-(1,1-difluoroethyl)cyclohexa-1,3-dien-1-yl]-2-oxoethyl]cycloheptyl]methyl]-N-(2-methoxyethyl)-3,7-dimethyl-3,4-dihydro-2-benzazepine-8-carboxamide |
|---|---|
| PubChem CID | 123647488 |
| Molecular Formula | C34H45ClF2N2O3 |
| Molecular Weight | 603.19 g/mol |
| Exact Mass | 602.31 |
| IUPAC Name | 2-[[4-[2-[4-chloro-3-(1,1-difluoroethyl)cyclohexa-1,3-dien-1-yl]-2-oxoethyl]cycloheptyl]methyl]-N-(2-methoxyethyl)-3,7-dimethyl-3,4-dihydro-2-benzazepine-8-carboxamide |
| SMILES | COCCNC(=O)c1cc2c(cc1C)=CCC(C)N(CC1CCCC(CC(=O)C3=CC(C(C)(F)F)=C(Cl)CC3)CC1)C=2 |
| InChI | InChI=1S/C34H45ClF2N2O3/c1-22-16-26-11-8-23(2)39(21-28(26)18-29(22)33(41)38-14-15-42-4)20-25-7-5-6-24(9-10-25)17-32(40)27-12-13-31(35)30(19-27)34(3,36)37/h11,16,18-19,21,23-25H,5-10,12-15,17,20H2,1-4H3,(H,38,41) |
| InChIKey | RRDRXROXUMKHIM-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.19 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|