C27H29ClN6O5 — CID 123648169
N-[3-[[5-chloro-4-[2-[2-(dimethylamino)-2-oxoacetyl]anilino]-2,5-dihydropyrimidin-2-yl]amino]-4-(oxolan-3-yloxy)phenyl]prop-2-enamide (PubChem CID 123648169) has the molecular formula C27H29ClN6O5 and a molecular weight of 553.02 g/mol. Its IUPAC name is N-[3-[[5-chloro-4-[2-[2-(dimethylamino)-2-oxoacetyl]anilino]-2,5-dihydropyrimidin-2-yl]amino]-4-(oxolan-3-yloxy)phenyl]prop-2-enamide.
| Compound Name | N-[3-[[5-chloro-4-[2-[2-(dimethylamino)-2-oxoacetyl]anilino]-2,5-dihydropyrimidin-2-yl]amino]-4-(oxolan-3-yloxy)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 123648169 |
| Molecular Formula | C27H29ClN6O5 |
| Molecular Weight | 553.02 g/mol |
| Exact Mass | 552.19 |
| IUPAC Name | N-[3-[[5-chloro-4-[2-[2-(dimethylamino)-2-oxoacetyl]anilino]-2,5-dihydropyrimidin-2-yl]amino]-4-(oxolan-3-yloxy)phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1ccc(OC2CCOC2)c(NC2N=CC(Cl)C(Nc3ccccc3C(=O)C(=O)N(C)C)=N2)c1 |
| InChI | InChI=1S/C27H29ClN6O5/c1-4-23(35)30-16-9-10-22(39-17-11-12-38-15-17)21(13-16)32-27-29-14-19(28)25(33-27)31-20-8-6-5-7-18(20)24(36)26(37)34(2)3/h4-10,13-14,17,19,27,32H,1,11-12,15H2,2-3H3,(H,30,35)(H,31,33) |
| InChIKey | GHYIQKDLOJKGMG-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 133.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.02 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|