About 5-[(2S,4S)-2-(difluoromethyl)-1-methylpiperidin-4-yl]-1,2-oxazol-3-one
5-[(2S,4S)-2-(difluoromethyl)-1-methylpiperidin-4-yl]-1,2-oxazol-3-one (PubChem CID 123648431) has the molecular formula C10H14F2N2O2
and a molecular weight of 232.23 g/mol. Its IUPAC name is 5-[(2S,4S)-2-(difluoromethyl)-1-methylpiperidin-4-yl]-1,2-oxazol-3-one.
Molecular Properties
| Compound Name | 5-[(2S,4S)-2-(difluoromethyl)-1-methylpiperidin-4-yl]-1,2-oxazol-3-one |
| PubChem CID | 123648431 |
| Molecular Formula | C10H14F2N2O2 |
| Molecular Weight | 232.23 g/mol |
| Exact Mass | 232.10 |
| IUPAC Name | 5-[(2S,4S)-2-(difluoromethyl)-1-methylpiperidin-4-yl]-1,2-oxazol-3-one |
| SMILES | CN1CC[C@H](c2cc(=O)[nH]o2)C[C@H]1C(F)F |
| InChI | InChI=1S/C10H14F2N2O2/c1-14-3-2-6(4-7(14)10(11)12)8-5-9(15)13-16-8/h5-7,10H,2-4H2,1H3,(H,13,15)/t6-,7-/m0/s1 |
| InChIKey | JLFQAMZARBVKHE-BQBZGAKWSA-N |
| XLogP | 1.41 |
| TPSA | 49.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.23 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-[(2S,4S)-2-(difluoromethyl)-1-methylpiperidin-4-yl]-1,2-oxazol-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(2S,4S)-2-(difluoromethyl)-1-methylpiperidin-4-yl]-1,2-oxazol-3-one?
The IUPAC name of 5-[(2S,4S)-2-(difluoromethyl)-1-methylpiperidin-4-yl]-1,2-oxazol-3-one (CID 123648431) is 5-[(2S,4S)-2-(difluoromethyl)-1-methylpiperidin-4-yl]-1,2-oxazol-3-one.
What is the SMILES notation for 5-[(2S,4S)-2-(difluoromethyl)-1-methylpiperidin-4-yl]-1,2-oxazol-3-one?
The canonical SMILES for 5-[(2S,4S)-2-(difluoromethyl)-1-methylpiperidin-4-yl]-1,2-oxazol-3-one is CN1CC[C@H](c2cc(=O)[nH]o2)C[C@H]1C(F)F.
What is the InChIKey of 5-[(2S,4S)-2-(difluoromethyl)-1-methylpiperidin-4-yl]-1,2-oxazol-3-one?
The InChIKey is JLFQAMZARBVKHE-BQBZGAKWSA-N. The full InChI is InChI=1S/C10H14F2N2O2/c1-14-3-2-6(4-7(14)10(11)12)8-5-9(15)13-16-8/h5-7,10H,2-4H2,1H3,(H,13,15)/t6-,7-/m0/s1.
What are the key properties of 5-[(2S,4S)-2-(difluoromethyl)-1-methylpiperidin-4-yl]-1,2-oxazol-3-one?
5-[(2S,4S)-2-(difluoromethyl)-1-methylpiperidin-4-yl]-1,2-oxazol-3-one has a molecular weight of 232.23 g/mol, XLogP of 1.41, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(2S,4S)-2-(difluoromethyl)-1-methylpiperidin-4-yl]-1,2-oxazol-3-one is sourced from PubChem (CID 123648431), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).