C23H25ClF2N6O — CID 123648521
3-N-[3-chloro-5-(1,1-difluorobut-2-enyl)-4-[4-(pyrrolidin-2-ylmethoxy)phenyl]phenyl]-1H-1,2,4-triazole-3,5-diamine (PubChem CID 123648521) has the molecular formula C23H25ClF2N6O and a molecular weight of 474.94 g/mol. Its IUPAC name is 3-N-[3-chloro-5-(1,1-difluorobut-2-enyl)-4-[4-(pyrrolidin-2-ylmethoxy)phenyl]phenyl]-1H-1,2,4-triazole-3,5-diamine.
| Compound Name | 3-N-[3-chloro-5-(1,1-difluorobut-2-enyl)-4-[4-(pyrrolidin-2-ylmethoxy)phenyl]phenyl]-1H-1,2,4-triazole-3,5-diamine |
|---|---|
| PubChem CID | 123648521 |
| Molecular Formula | C23H25ClF2N6O |
| Molecular Weight | 474.94 g/mol |
| Exact Mass | 474.17 |
| IUPAC Name | 3-N-[3-chloro-5-(1,1-difluorobut-2-enyl)-4-[4-(pyrrolidin-2-ylmethoxy)phenyl]phenyl]-1H-1,2,4-triazole-3,5-diamine |
| SMILES | CC=CC(F)(F)c1cc(Nc2n[nH]c(N)n2)cc(Cl)c1-c1ccc(OCC2CCCN2)cc1 |
| InChI | InChI=1S/C23H25ClF2N6O/c1-2-9-23(25,26)18-11-16(29-22-30-21(27)31-32-22)12-19(24)20(18)14-5-7-17(8-6-14)33-13-15-4-3-10-28-15/h2,5-9,11-12,15,28H,3-4,10,13H2,1H3,(H4,27,29,30,31,32) |
| InChIKey | SOSXEMTZBJRZKQ-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 100.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.94 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|