C22H27N9 — CID 123648611
1-[4-(4-aminophenyl)-5-(1,4-dimethyl-5H-pyrazolo[4,5-d]pyrimidin-5-yl)pyrimidin-2-yl]piperidin-4-amine (PubChem CID 123648611) has the molecular formula C22H27N9 and a molecular weight of 417.52 g/mol. Its IUPAC name is 1-[4-(4-aminophenyl)-5-(1,4-dimethyl-5H-pyrazolo[4,5-d]pyrimidin-5-yl)pyrimidin-2-yl]piperidin-4-amine.
| Compound Name | 1-[4-(4-aminophenyl)-5-(1,4-dimethyl-5H-pyrazolo[4,5-d]pyrimidin-5-yl)pyrimidin-2-yl]piperidin-4-amine |
|---|---|
| PubChem CID | 123648611 |
| Molecular Formula | C22H27N9 |
| Molecular Weight | 417.52 g/mol |
| Exact Mass | 417.24 |
| IUPAC Name | 1-[4-(4-aminophenyl)-5-(1,4-dimethyl-5H-pyrazolo[4,5-d]pyrimidin-5-yl)pyrimidin-2-yl]piperidin-4-amine |
| SMILES | CN1c2cnn(C)c2C=NC1c1cnc(N2CCC(N)CC2)nc1-c1ccc(N)cc1 |
| InChI | InChI=1S/C22H27N9/c1-29-18-13-27-30(2)19(18)12-25-21(29)17-11-26-22(31-9-7-16(24)8-10-31)28-20(17)14-3-5-15(23)6-4-14/h3-6,11-13,16,21H,7-10,23-24H2,1-2H3 |
| InChIKey | WMVRTJKUMUNJBK-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 114.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.52 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|