C29H34O7 — CID 123648967
(4aR,12aS)-2-acetyl-9-tert-butyl-10,11,12a-trihydroxy-4a,6-dimethyl-4-propan-2-yl-4,5-dihydrotetracene-1,3,12-trione (PubChem CID 123648967) has the molecular formula C29H34O7 and a molecular weight of 494.58 g/mol. Its IUPAC name is (4aR,12aS)-2-acetyl-9-tert-butyl-10,11,12a-trihydroxy-4a,6-dimethyl-4-propan-2-yl-4,5-dihydrotetracene-1,3,12-trione.
| Compound Name | (4aR,12aS)-2-acetyl-9-tert-butyl-10,11,12a-trihydroxy-4a,6-dimethyl-4-propan-2-yl-4,5-dihydrotetracene-1,3,12-trione |
|---|---|
| PubChem CID | 123648967 |
| Molecular Formula | C29H34O7 |
| Molecular Weight | 494.58 g/mol |
| Exact Mass | 494.23 |
| IUPAC Name | (4aR,12aS)-2-acetyl-9-tert-butyl-10,11,12a-trihydroxy-4a,6-dimethyl-4-propan-2-yl-4,5-dihydrotetracene-1,3,12-trione |
| SMILES | CC(=O)C1C(=O)C(C(C)C)[C@@]2(C)Cc3c(c(O)c4c(O)c(C(C)(C)C)ccc4c3C)C(=O)[C@@]2(O)C1=O |
| InChI | InChI=1S/C29H34O7/c1-12(2)21-24(33)18(14(4)30)25(34)29(36)26(35)20-16(11-28(21,29)8)13(3)15-9-10-17(27(5,6)7)22(31)19(15)23(20)32/h9-10,12,18,21,31-32,36H,11H2,1-8H3/t18?,21?,28-,29+/m1/s1 |
| InChIKey | NTXAAEAJHVQMNS-KLZKYGILSA-N |
| XLogP | 3.96 |
| TPSA | 128.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.58 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|