C23H26FN3O3S — CID 123649209
4-[3-[6-fluoro-4-(2-methylsulfonylethyl)indazol-1-yl]-4-hydroxyhexan-3-yl]benzonitrile (PubChem CID 123649209) has the molecular formula C23H26FN3O3S and a molecular weight of 443.54 g/mol. Its IUPAC name is 4-[3-[6-fluoro-4-(2-methylsulfonylethyl)indazol-1-yl]-4-hydroxyhexan-3-yl]benzonitrile.
| Compound Name | 4-[3-[6-fluoro-4-(2-methylsulfonylethyl)indazol-1-yl]-4-hydroxyhexan-3-yl]benzonitrile |
|---|---|
| PubChem CID | 123649209 |
| Molecular Formula | C23H26FN3O3S |
| Molecular Weight | 443.54 g/mol |
| Exact Mass | 443.17 |
| IUPAC Name | 4-[3-[6-fluoro-4-(2-methylsulfonylethyl)indazol-1-yl]-4-hydroxyhexan-3-yl]benzonitrile |
| SMILES | CCC(O)C(CC)(c1ccc(C#N)cc1)n1ncc2c(CCS(C)(=O)=O)cc(F)cc21 |
| InChI | InChI=1S/C23H26FN3O3S/c1-4-22(28)23(5-2,18-8-6-16(14-25)7-9-18)27-21-13-19(24)12-17(20(21)15-26-27)10-11-31(3,29)30/h6-9,12-13,15,22,28H,4-5,10-11H2,1-3H3 |
| InChIKey | YDCUAUKPAMTMTL-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 95.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.54 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |