C34H33BN2O6 — CID 123649487
carbon dioxide;ethyl 4-(11-cyclopropylbenzo[b][1,4]benzodiazepin-6-yl)benzoate;(4-ethylphenyl)boronic acid (PubChem CID 123649487) has the molecular formula C34H33BN2O6 and a molecular weight of 576.46 g/mol. Its IUPAC name is carbon dioxide;ethyl 4-(11-cyclopropylbenzo[b][1,4]benzodiazepin-6-yl)benzoate;(4-ethylphenyl)boronic acid.
| Compound Name | carbon dioxide;ethyl 4-(11-cyclopropylbenzo[b][1,4]benzodiazepin-6-yl)benzoate;(4-ethylphenyl)boronic acid |
|---|---|
| PubChem CID | 123649487 |
| Molecular Formula | C34H33BN2O6 |
| Molecular Weight | 576.46 g/mol |
| Exact Mass | 576.24 |
| IUPAC Name | carbon dioxide;ethyl 4-(11-cyclopropylbenzo[b][1,4]benzodiazepin-6-yl)benzoate;(4-ethylphenyl)boronic acid |
| SMILES | CCOC(=O)c1ccc(C2=Nc3ccccc3N(C3CC3)c3ccccc32)cc1.CCc1ccc(B(O)O)cc1.O=C=O |
| InChI | InChI=1S/C25H22N2O2.C8H11BO2.CO2/c1-2-29-25(28)18-13-11-17(12-14-18)24-20-7-3-5-9-22(20)27(19-15-16-19)23-10-6-4-8-21(23)26-24;1-2-7-3-5-8(6-4-7)9(10)11;2-1-3/h3-14,19H,2,15-16H2,1H3;3-6,10-11H,2H2,1H3; |
| InChIKey | KDDKAWFMAKMWSB-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 116.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.46 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|