C25H31N3O2S — CID 123649742
1-[1-(2,4-dihydroxy-5-propan-2-ylphenyl)but-1-enyl]-1-(1,3-dimethylindol-5-yl)-3-methylthiourea (PubChem CID 123649742) has the molecular formula C25H31N3O2S and a molecular weight of 437.61 g/mol. Its IUPAC name is 1-[1-(2,4-dihydroxy-5-propan-2-ylphenyl)but-1-enyl]-1-(1,3-dimethylindol-5-yl)-3-methylthiourea.
| Compound Name | 1-[1-(2,4-dihydroxy-5-propan-2-ylphenyl)but-1-enyl]-1-(1,3-dimethylindol-5-yl)-3-methylthiourea |
|---|---|
| PubChem CID | 123649742 |
| Molecular Formula | C25H31N3O2S |
| Molecular Weight | 437.61 g/mol |
| Exact Mass | 437.21 |
| IUPAC Name | 1-[1-(2,4-dihydroxy-5-propan-2-ylphenyl)but-1-enyl]-1-(1,3-dimethylindol-5-yl)-3-methylthiourea |
| SMILES | CCC=C(c1cc(C(C)C)c(O)cc1O)N(C(=S)NC)c1ccc2c(c1)c(C)cn2C |
| InChI | InChI=1S/C25H31N3O2S/c1-7-8-22(20-12-18(15(2)3)23(29)13-24(20)30)28(25(31)26-5)17-9-10-21-19(11-17)16(4)14-27(21)6/h8-15,29-30H,7H2,1-6H3,(H,26,31) |
| InChIKey | UNFMROGKHKOUFL-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 60.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.61 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|