C14H24N4S2 — CID 123650591
6-(3-cyclooctylpropylamino)-1H-1,3,5-triazine-2,4-dithione (PubChem CID 123650591) has the molecular formula C14H24N4S2 and a molecular weight of 312.51 g/mol. Its IUPAC name is 6-(3-cyclooctylpropylamino)-1H-1,3,5-triazine-2,4-dithione.
| Compound Name | 6-(3-cyclooctylpropylamino)-1H-1,3,5-triazine-2,4-dithione |
|---|---|
| PubChem CID | 123650591 |
| Molecular Formula | C14H24N4S2 |
| Molecular Weight | 312.51 g/mol |
| Exact Mass | 312.14 |
| IUPAC Name | 6-(3-cyclooctylpropylamino)-1H-1,3,5-triazine-2,4-dithione |
| SMILES | S=c1nc(NCCCC2CCCCCCC2)[nH]c(=S)[nH]1 |
| InChI | InChI=1S/C14H24N4S2/c19-13-16-12(17-14(20)18-13)15-10-6-9-11-7-4-2-1-3-5-8-11/h11H,1-10H2,(H3,15,16,17,18,19,20) |
| InChIKey | QYXGSTSDTJMRCO-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 56.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.51 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|