C25H28BrN11O4S — CID 123650789
5-amino-4-[4-[2-[6-amino-8-[(6-bromo-1,3-benzodioxol-5-yl)sulfanyl]purin-9-yl]ethyl]piperidine-1-carbonyl]-N-methylimidazole-1-carbohydrazide (PubChem CID 123650789) has the molecular formula C25H28BrN11O4S and a molecular weight of 658.54 g/mol. Its IUPAC name is 5-amino-4-[4-[2-[6-amino-8-[(6-bromo-1,3-benzodioxol-5-yl)sulfanyl]purin-9-yl]ethyl]piperidine-1-carbonyl]-N-methylimidazole-1-carbohydrazide.
| Compound Name | 5-amino-4-[4-[2-[6-amino-8-[(6-bromo-1,3-benzodioxol-5-yl)sulfanyl]purin-9-yl]ethyl]piperidine-1-carbonyl]-N-methylimidazole-1-carbohydrazide |
|---|---|
| PubChem CID | 123650789 |
| Molecular Formula | C25H28BrN11O4S |
| Molecular Weight | 658.54 g/mol |
| Exact Mass | 657.12 |
| IUPAC Name | 5-amino-4-[4-[2-[6-amino-8-[(6-bromo-1,3-benzodioxol-5-yl)sulfanyl]purin-9-yl]ethyl]piperidine-1-carbonyl]-N-methylimidazole-1-carbohydrazide |
| SMILES | CN(N)C(=O)n1cnc(C(=O)N2CCC(CCn3c(Sc4cc5c(cc4Br)OCO5)nc4c(N)ncnc43)CC2)c1N |
| InChI | InChI=1S/C25H28BrN11O4S/c1-34(29)25(39)37-11-32-19(21(37)28)23(38)35-5-2-13(3-6-35)4-7-36-22-18(20(27)30-10-31-22)33-24(36)42-17-9-16-15(8-14(17)26)40-12-41-16/h8-11,13H,2-7,12,28-29H2,1H3,(H2,27,30,31) |
| InChIKey | YFUVHOBGUDQXRV-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 198.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.54 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|