C19H17Cl2F3N4O3 — CID 123651502
4,6-dichloro-N-(2-hydroxyethyl)-N-[5-(2,2,2-trifluoroethoxyimino)-7,8-dihydro-6H-naphthalen-2-yl]pyrimidine-5-carboxamide (PubChem CID 123651502) has the molecular formula C19H17Cl2F3N4O3 and a molecular weight of 477.27 g/mol. Its IUPAC name is 4,6-dichloro-N-(2-hydroxyethyl)-N-[5-(2,2,2-trifluoroethoxyimino)-7,8-dihydro-6H-naphthalen-2-yl]pyrimidine-5-carboxamide.
| Compound Name | 4,6-dichloro-N-(2-hydroxyethyl)-N-[5-(2,2,2-trifluoroethoxyimino)-7,8-dihydro-6H-naphthalen-2-yl]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 123651502 |
| Molecular Formula | C19H17Cl2F3N4O3 |
| Molecular Weight | 477.27 g/mol |
| Exact Mass | 476.06 |
| IUPAC Name | 4,6-dichloro-N-(2-hydroxyethyl)-N-[5-(2,2,2-trifluoroethoxyimino)-7,8-dihydro-6H-naphthalen-2-yl]pyrimidine-5-carboxamide |
| SMILES | O=C(c1c(Cl)ncnc1Cl)N(CCO)c1ccc2c(c1)CCCC2=NOCC(F)(F)F |
| InChI | InChI=1S/C19H17Cl2F3N4O3/c20-16-15(17(21)26-10-25-16)18(30)28(6-7-29)12-4-5-13-11(8-12)2-1-3-14(13)27-31-9-19(22,23)24/h4-5,8,10,29H,1-3,6-7,9H2 |
| InChIKey | UPAQYFJVXPENKD-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 87.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.27 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|