C8H16O3S2 — CID 123651540
1,1-dimethoxy-4,4-bis(methylsulfanyl)butan-2-one (PubChem CID 123651540) has the molecular formula C8H16O3S2 and a molecular weight of 224.35 g/mol. Its IUPAC name is 1,1-dimethoxy-4,4-bis(methylsulfanyl)butan-2-one.
| Compound Name | 1,1-dimethoxy-4,4-bis(methylsulfanyl)butan-2-one |
|---|---|
| PubChem CID | 123651540 |
| Molecular Formula | C8H16O3S2 |
| Molecular Weight | 224.35 g/mol |
| Exact Mass | 224.05 |
| IUPAC Name | 1,1-dimethoxy-4,4-bis(methylsulfanyl)butan-2-one |
| SMILES | COC(OC)C(=O)CC(SC)SC |
| InChI | InChI=1S/C8H16O3S2/c1-10-8(11-2)6(9)5-7(12-3)13-4/h7-8H,5H2,1-4H3 |
| InChIKey | ZGQPEQBJBRIQTL-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.35 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|