About 1,1-dimethoxy-4,4-bis(methylsulfanyl)butan-2-one
1,1-dimethoxy-4,4-bis(methylsulfanyl)butan-2-one (PubChem CID 123651540) has the molecular formula C8H16O3S2
and a molecular weight of 224.35 g/mol. Its IUPAC name is 1,1-dimethoxy-4,4-bis(methylsulfanyl)butan-2-one.
Molecular Properties
| Compound Name | 1,1-dimethoxy-4,4-bis(methylsulfanyl)butan-2-one |
| PubChem CID | 123651540 |
| Molecular Formula | C8H16O3S2 |
| Molecular Weight | 224.35 g/mol |
| Exact Mass | 224.05 |
| IUPAC Name | 1,1-dimethoxy-4,4-bis(methylsulfanyl)butan-2-one |
| SMILES | COC(OC)C(=O)CC(SC)SC |
| InChI | InChI=1S/C8H16O3S2/c1-10-8(11-2)6(9)5-7(12-3)13-4/h7-8H,5H2,1-4H3 |
| InChIKey | ZGQPEQBJBRIQTL-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.35 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1,1-dimethoxy-4,4-bis(methylsulfanyl)butan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-dimethoxy-4,4-bis(methylsulfanyl)butan-2-one?
The IUPAC name of 1,1-dimethoxy-4,4-bis(methylsulfanyl)butan-2-one (CID 123651540) is 1,1-dimethoxy-4,4-bis(methylsulfanyl)butan-2-one.
What is the SMILES notation for 1,1-dimethoxy-4,4-bis(methylsulfanyl)butan-2-one?
The canonical SMILES for 1,1-dimethoxy-4,4-bis(methylsulfanyl)butan-2-one is COC(OC)C(=O)CC(SC)SC.
What is the InChIKey of 1,1-dimethoxy-4,4-bis(methylsulfanyl)butan-2-one?
The InChIKey is ZGQPEQBJBRIQTL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16O3S2/c1-10-8(11-2)6(9)5-7(12-3)13-4/h7-8H,5H2,1-4H3.
What are the key properties of 1,1-dimethoxy-4,4-bis(methylsulfanyl)butan-2-one?
1,1-dimethoxy-4,4-bis(methylsulfanyl)butan-2-one has a molecular weight of 224.35 g/mol, XLogP of 1.62, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-dimethoxy-4,4-bis(methylsulfanyl)butan-2-one is sourced from PubChem (CID 123651540), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).