C38H52N2O8SSi2 — CID 123651748
4-[bis(2-trimethylsilylethoxymethyl)sulfamoyl]-3-[4-[[(1R)-4-(4-isocyanophenoxy)-2,3-dihydro-1H-inden-1-yl]oxy]phenyl]butanoic acid (PubChem CID 123651748) has the molecular formula C38H52N2O8SSi2 and a molecular weight of 753.08 g/mol. Its IUPAC name is 4-[bis(2-trimethylsilylethoxymethyl)sulfamoyl]-3-[4-[[(1R)-4-(4-isocyanophenoxy)-2,3-dihydro-1H-inden-1-yl]oxy]phenyl]butanoic acid.
| Compound Name | 4-[bis(2-trimethylsilylethoxymethyl)sulfamoyl]-3-[4-[[(1R)-4-(4-isocyanophenoxy)-2,3-dihydro-1H-inden-1-yl]oxy]phenyl]butanoic acid |
|---|---|
| PubChem CID | 123651748 |
| Molecular Formula | C38H52N2O8SSi2 |
| Molecular Weight | 753.08 g/mol |
| Exact Mass | 752.30 |
| IUPAC Name | 4-[bis(2-trimethylsilylethoxymethyl)sulfamoyl]-3-[4-[[(1R)-4-(4-isocyanophenoxy)-2,3-dihydro-1H-inden-1-yl]oxy]phenyl]butanoic acid |
| SMILES | [C-]#[N+]c1ccc(Oc2cccc3c2CC[C@H]3Oc2ccc(C(CC(=O)O)CS(=O)(=O)N(COCC[Si](C)(C)C)COCC[Si](C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C38H52N2O8SSi2/c1-39-31-13-17-33(18-14-31)47-36-10-8-9-34-35(36)19-20-37(34)48-32-15-11-29(12-16-32)30(25-38(41)42)26-49(43,44)40(27-45-21-23-50(2,3)4)28-46-22-24-51(5,6)7/h8-18,30,37H,19-28H2,2-7H3,(H,41,42)/t30?,37-/m1/s1 |
| InChIKey | IXMMPAPHGONKNY-ZUTSRIDHSA-N |
| XLogP | 8.91 |
| TPSA | 115.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 753.08 |
| LogP ≤ 5 | 8.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|