C25H29ClN4O2 — CID 123651868
N-(8-chloro-2-oxo-1,3,4,5-tetrahydro-1-benzazepin-3-yl)-2-[2-(4-methylphenyl)ethylidenehydrazinylidene]hexanamide (PubChem CID 123651868) has the molecular formula C25H29ClN4O2 and a molecular weight of 452.99 g/mol. Its IUPAC name is N-(8-chloro-2-oxo-1,3,4,5-tetrahydro-1-benzazepin-3-yl)-2-[2-(4-methylphenyl)ethylidenehydrazinylidene]hexanamide.
| Compound Name | N-(8-chloro-2-oxo-1,3,4,5-tetrahydro-1-benzazepin-3-yl)-2-[2-(4-methylphenyl)ethylidenehydrazinylidene]hexanamide |
|---|---|
| PubChem CID | 123651868 |
| Molecular Formula | C25H29ClN4O2 |
| Molecular Weight | 452.99 g/mol |
| Exact Mass | 452.20 |
| IUPAC Name | N-(8-chloro-2-oxo-1,3,4,5-tetrahydro-1-benzazepin-3-yl)-2-[2-(4-methylphenyl)ethylidenehydrazinylidene]hexanamide |
| SMILES | CCCCC(=NN=CCc1ccc(C)cc1)C(=O)NC1CCc2ccc(Cl)cc2NC1=O |
| InChI | InChI=1S/C25H29ClN4O2/c1-3-4-5-22(30-27-15-14-18-8-6-17(2)7-9-18)25(32)28-21-13-11-19-10-12-20(26)16-23(19)29-24(21)31/h6-10,12,15-16,21H,3-5,11,13-14H2,1-2H3,(H,28,32)(H,29,31) |
| InChIKey | VQBWYLVFYZMNBO-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 82.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.99 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|