C21H22O5 — CID 123651993
methyl (1S,7S)-7-methyl-3,5-dioxo-4-(2,4,6-trimethylphenyl)-10-oxatricyclo[5.2.1.02,6]dec-8-ene-8-carboxylate (PubChem CID 123651993) has the molecular formula C21H22O5 and a molecular weight of 354.40 g/mol. Its IUPAC name is methyl (1S,7S)-7-methyl-3,5-dioxo-4-(2,4,6-trimethylphenyl)-10-oxatricyclo[5.2.1.02,6]dec-8-ene-8-carboxylate.
| Compound Name | methyl (1S,7S)-7-methyl-3,5-dioxo-4-(2,4,6-trimethylphenyl)-10-oxatricyclo[5.2.1.02,6]dec-8-ene-8-carboxylate |
|---|---|
| PubChem CID | 123651993 |
| Molecular Formula | C21H22O5 |
| Molecular Weight | 354.40 g/mol |
| Exact Mass | 354.15 |
| IUPAC Name | methyl (1S,7S)-7-methyl-3,5-dioxo-4-(2,4,6-trimethylphenyl)-10-oxatricyclo[5.2.1.02,6]dec-8-ene-8-carboxylate |
| SMILES | COC(=O)C1=C[C@@H]2O[C@@]1(C)C1C(=O)C(c3c(C)cc(C)cc3C)C(=O)C12 |
| InChI | InChI=1S/C21H22O5/c1-9-6-10(2)14(11(3)7-9)16-18(22)15-13-8-12(20(24)25-5)21(4,26-13)17(15)19(16)23/h6-8,13,15-17H,1-5H3/t13-,15?,16?,17?,21+/m0/s1 |
| InChIKey | FSIMPYATIMRVIY-ZTKOQYSCSA-N |
| XLogP | 2.35 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.40 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|