C47H31N5 — CID 123652217
10-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-1,7-diphenylpyrrolo[2,3-a]carbazole (PubChem CID 123652217) has the molecular formula C47H31N5 and a molecular weight of 665.80 g/mol. Its IUPAC name is 10-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-1,7-diphenylpyrrolo[2,3-a]carbazole.
| Compound Name | 10-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-1,7-diphenylpyrrolo[2,3-a]carbazole |
|---|---|
| PubChem CID | 123652217 |
| Molecular Formula | C47H31N5 |
| Molecular Weight | 665.80 g/mol |
| Exact Mass | 665.26 |
| IUPAC Name | 10-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-1,7-diphenylpyrrolo[2,3-a]carbazole |
| SMILES | c1ccc(-c2ccc3c(c2)c2ccc4ccn(-c5ccccc5)c4c2n3-c2cccc(-c3nc(-c4ccccc4)nc(-c4ccccc4)n3)c2)cc1 |
| InChI | InChI=1S/C47H31N5/c1-5-14-32(15-6-1)36-25-27-42-41(31-36)40-26-24-33-28-29-51(38-21-11-4-12-22-38)43(33)44(40)52(42)39-23-13-20-37(30-39)47-49-45(34-16-7-2-8-17-34)48-46(50-47)35-18-9-3-10-19-35/h1-31H |
| InChIKey | UWDHUIGSPRFBKB-UHFFFAOYSA-N |
| XLogP | 11.58 |
| TPSA | 48.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.80 |
| LogP ≤ 5 | 11.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |