About 2-methylpropyl 2-oxo-3H-1,3-thiazole-4-carboxylate
2-methylpropyl 2-oxo-3H-1,3-thiazole-4-carboxylate (PubChem CID 123652281) has the molecular formula C8H11NO3S
and a molecular weight of 201.25 g/mol. Its IUPAC name is 2-methylpropyl 2-oxo-3H-1,3-thiazole-4-carboxylate.
Molecular Properties
| Compound Name | 2-methylpropyl 2-oxo-3H-1,3-thiazole-4-carboxylate |
| PubChem CID | 123652281 |
| Molecular Formula | C8H11NO3S |
| Molecular Weight | 201.25 g/mol |
| Exact Mass | 201.05 |
| IUPAC Name | 2-methylpropyl 2-oxo-3H-1,3-thiazole-4-carboxylate |
| SMILES | CC(C)COC(=O)c1csc(=O)[nH]1 |
| InChI | InChI=1S/C8H11NO3S/c1-5(2)3-12-7(10)6-4-13-8(11)9-6/h4-5H,3H2,1-2H3,(H,9,11) |
| InChIKey | OHBJSPGUGGCMGI-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 59.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.25 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-methylpropyl 2-oxo-3H-1,3-thiazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpropyl 2-oxo-3H-1,3-thiazole-4-carboxylate?
The IUPAC name of 2-methylpropyl 2-oxo-3H-1,3-thiazole-4-carboxylate (CID 123652281) is 2-methylpropyl 2-oxo-3H-1,3-thiazole-4-carboxylate.
What is the SMILES notation for 2-methylpropyl 2-oxo-3H-1,3-thiazole-4-carboxylate?
The canonical SMILES for 2-methylpropyl 2-oxo-3H-1,3-thiazole-4-carboxylate is CC(C)COC(=O)c1csc(=O)[nH]1.
What is the InChIKey of 2-methylpropyl 2-oxo-3H-1,3-thiazole-4-carboxylate?
The InChIKey is OHBJSPGUGGCMGI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11NO3S/c1-5(2)3-12-7(10)6-4-13-8(11)9-6/h4-5H,3H2,1-2H3,(H,9,11).
What are the key properties of 2-methylpropyl 2-oxo-3H-1,3-thiazole-4-carboxylate?
2-methylpropyl 2-oxo-3H-1,3-thiazole-4-carboxylate has a molecular weight of 201.25 g/mol, XLogP of 1.25, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpropyl 2-oxo-3H-1,3-thiazole-4-carboxylate is sourced from PubChem (CID 123652281), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).