C21H24N2O — CID 123652990
1-(5-ethylhepta-1,3,5-trien-3-yl)-7,8-di(ethylidene)-1,6-naphthyridin-2-one (PubChem CID 123652990) has the molecular formula C21H24N2O and a molecular weight of 320.44 g/mol. Its IUPAC name is 1-(5-ethylhepta-1,3,5-trien-3-yl)-7,8-di(ethylidene)-1,6-naphthyridin-2-one.
| Compound Name | 1-(5-ethylhepta-1,3,5-trien-3-yl)-7,8-di(ethylidene)-1,6-naphthyridin-2-one |
|---|---|
| PubChem CID | 123652990 |
| Molecular Formula | C21H24N2O |
| Molecular Weight | 320.44 g/mol |
| Exact Mass | 320.19 |
| IUPAC Name | 1-(5-ethylhepta-1,3,5-trien-3-yl)-7,8-di(ethylidene)-1,6-naphthyridin-2-one |
| SMILES | C=CC(=CC(=CC)CC)n1c(=O)ccc2cnc(=CC)c(=CC)c21 |
| InChI | InChI=1S/C21H24N2O/c1-6-15(7-2)13-17(8-3)23-20(24)12-11-16-14-22-19(10-5)18(9-4)21(16)23/h6,8-14H,3,7H2,1-2,4-5H3 |
| InChIKey | JIVOVXVFAZNADY-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.44 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|