About 6-ethenyl-3,6-dimethyl-1-pentan-3-ylcyclododecene
6-ethenyl-3,6-dimethyl-1-pentan-3-ylcyclododecene (PubChem CID 123653054) has the molecular formula C21H38
and a molecular weight of 290.54 g/mol. Its IUPAC name is 6-ethenyl-3,6-dimethyl-1-pentan-3-ylcyclododecene.
Molecular Properties
| Compound Name | 6-ethenyl-3,6-dimethyl-1-pentan-3-ylcyclododecene |
| PubChem CID | 123653054 |
| Molecular Formula | C21H38 |
| Molecular Weight | 290.54 g/mol |
| Exact Mass | 290.30 |
| IUPAC Name | 6-ethenyl-3,6-dimethyl-1-pentan-3-ylcyclododecene |
| SMILES | C=CC1(C)CCCCCCC(C(CC)CC)=CC(C)CC1 |
| InChI | InChI=1S/C21H38/c1-6-19(7-2)20-13-11-9-10-12-15-21(5,8-3)16-14-18(4)17-20/h8,17-19H,3,6-7,9-16H2,1-2,4-5H3 |
| InChIKey | IKHKGJWYHXVNEY-UHFFFAOYSA-N |
| XLogP | 7.31 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 290.54 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 6-ethenyl-3,6-dimethyl-1-pentan-3-ylcyclododecene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-ethenyl-3,6-dimethyl-1-pentan-3-ylcyclododecene?
The IUPAC name of 6-ethenyl-3,6-dimethyl-1-pentan-3-ylcyclododecene (CID 123653054) is 6-ethenyl-3,6-dimethyl-1-pentan-3-ylcyclododecene.
What is the SMILES notation for 6-ethenyl-3,6-dimethyl-1-pentan-3-ylcyclododecene?
The canonical SMILES for 6-ethenyl-3,6-dimethyl-1-pentan-3-ylcyclododecene is C=CC1(C)CCCCCCC(C(CC)CC)=CC(C)CC1.
What is the InChIKey of 6-ethenyl-3,6-dimethyl-1-pentan-3-ylcyclododecene?
The InChIKey is IKHKGJWYHXVNEY-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H38/c1-6-19(7-2)20-13-11-9-10-12-15-21(5,8-3)16-14-18(4)17-20/h8,17-19H,3,6-7,9-16H2,1-2,4-5H3.
What are the key properties of 6-ethenyl-3,6-dimethyl-1-pentan-3-ylcyclododecene?
6-ethenyl-3,6-dimethyl-1-pentan-3-ylcyclododecene has a molecular weight of 290.54 g/mol, XLogP of 7.31, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 6-ethenyl-3,6-dimethyl-1-pentan-3-ylcyclododecene is sourced from PubChem (CID 123653054), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).