About 7-amino-5,5-dimethyl-10-(2-methylphenyl)benzo[b][1]benzosilin-3-one
7-amino-5,5-dimethyl-10-(2-methylphenyl)benzo[b][1]benzosilin-3-one (PubChem CID 123653282) has the molecular formula C22H21NOSi
and a molecular weight of 343.50 g/mol. Its IUPAC name is 7-amino-5,5-dimethyl-10-(2-methylphenyl)benzo[b][1]benzosilin-3-one.
Molecular Properties
| Compound Name | 7-amino-5,5-dimethyl-10-(2-methylphenyl)benzo[b][1]benzosilin-3-one |
| PubChem CID | 123653282 |
| Molecular Formula | C22H21NOSi |
| Molecular Weight | 343.50 g/mol |
| Exact Mass | 343.14 |
| IUPAC Name | 7-amino-5,5-dimethyl-10-(2-methylphenyl)benzo[b][1]benzosilin-3-one |
| SMILES | Cc1ccccc1C1=C2C=CC(=O)C=C2[Si](C)(C)c2cc(N)ccc21 |
| InChI | InChI=1S/C22H21NOSi/c1-14-6-4-5-7-17(14)22-18-10-8-15(23)12-20(18)25(2,3)21-13-16(24)9-11-19(21)22/h4-13H,23H2,1-3H3 |
| InChIKey | JCOPOXZQSCLGHC-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.50 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 7-amino-5,5-dimethyl-10-(2-methylphenyl)benzo[b][1]benzosilin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-amino-5,5-dimethyl-10-(2-methylphenyl)benzo[b][1]benzosilin-3-one?
The IUPAC name of 7-amino-5,5-dimethyl-10-(2-methylphenyl)benzo[b][1]benzosilin-3-one (CID 123653282) is 7-amino-5,5-dimethyl-10-(2-methylphenyl)benzo[b][1]benzosilin-3-one.
What is the SMILES notation for 7-amino-5,5-dimethyl-10-(2-methylphenyl)benzo[b][1]benzosilin-3-one?
The canonical SMILES for 7-amino-5,5-dimethyl-10-(2-methylphenyl)benzo[b][1]benzosilin-3-one is Cc1ccccc1C1=C2C=CC(=O)C=C2[Si](C)(C)c2cc(N)ccc21.
What is the InChIKey of 7-amino-5,5-dimethyl-10-(2-methylphenyl)benzo[b][1]benzosilin-3-one?
The InChIKey is JCOPOXZQSCLGHC-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H21NOSi/c1-14-6-4-5-7-17(14)22-18-10-8-15(23)12-20(18)25(2,3)21-13-16(24)9-11-19(21)22/h4-13H,23H2,1-3H3.
What are the key properties of 7-amino-5,5-dimethyl-10-(2-methylphenyl)benzo[b][1]benzosilin-3-one?
7-amino-5,5-dimethyl-10-(2-methylphenyl)benzo[b][1]benzosilin-3-one has a molecular weight of 343.50 g/mol, XLogP of 3.91, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-amino-5,5-dimethyl-10-(2-methylphenyl)benzo[b][1]benzosilin-3-one is sourced from PubChem (CID 123653282), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).