About 10H-pyrido[2,3-b]carbazol-1-ium
10H-pyrido[2,3-b]carbazol-1-ium (PubChem CID 123653836) has the molecular formula C15H11N2+
and a molecular weight of 219.27 g/mol. Its IUPAC name is 10H-pyrido[2,3-b]carbazol-1-ium.
Molecular Properties
| Compound Name | 10H-pyrido[2,3-b]carbazol-1-ium |
| PubChem CID | 123653836 |
| Molecular Formula | C15H11N2+ |
| Molecular Weight | 219.27 g/mol |
| Exact Mass | 219.09 |
| IUPAC Name | 10H-pyrido[2,3-b]carbazol-1-ium |
| SMILES | c1c[nH+]c2cc3[nH]c4ccccc4c3cc2c1 |
| InChI | InChI=1S/C15H10N2/c1-2-6-13-11(5-1)12-8-10-4-3-7-16-14(10)9-15(12)17-13/h1-9,17H/p+1 |
| InChIKey | JTYREINXIICDCO-UHFFFAOYSA-O |
| XLogP | 3.29 |
| TPSA | 29.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.27 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 10H-pyrido[2,3-b]carbazol-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10H-pyrido[2,3-b]carbazol-1-ium?
The IUPAC name of 10H-pyrido[2,3-b]carbazol-1-ium (CID 123653836) is 10H-pyrido[2,3-b]carbazol-1-ium.
What is the SMILES notation for 10H-pyrido[2,3-b]carbazol-1-ium?
The canonical SMILES for 10H-pyrido[2,3-b]carbazol-1-ium is c1c[nH+]c2cc3[nH]c4ccccc4c3cc2c1.
What is the InChIKey of 10H-pyrido[2,3-b]carbazol-1-ium?
The InChIKey is JTYREINXIICDCO-UHFFFAOYSA-O. The full InChI is InChI=1S/C15H10N2/c1-2-6-13-11(5-1)12-8-10-4-3-7-16-14(10)9-15(12)17-13/h1-9,17H/p+1.
What are the key properties of 10H-pyrido[2,3-b]carbazol-1-ium?
10H-pyrido[2,3-b]carbazol-1-ium has a molecular weight of 219.27 g/mol, XLogP of 3.29, 0 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 10H-pyrido[2,3-b]carbazol-1-ium is sourced from PubChem (CID 123653836), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).