About 1-(4-phenyl-4,5-dihydro-1,3-oxazol-2-yl)propan-1-amine
1-(4-phenyl-4,5-dihydro-1,3-oxazol-2-yl)propan-1-amine (PubChem CID 123654244) has the molecular formula C12H16N2O
and a molecular weight of 204.27 g/mol. Its IUPAC name is 1-(4-phenyl-4,5-dihydro-1,3-oxazol-2-yl)propan-1-amine.
Molecular Properties
| Compound Name | 1-(4-phenyl-4,5-dihydro-1,3-oxazol-2-yl)propan-1-amine |
| PubChem CID | 123654244 |
| Molecular Formula | C12H16N2O |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.13 |
| IUPAC Name | 1-(4-phenyl-4,5-dihydro-1,3-oxazol-2-yl)propan-1-amine |
| SMILES | CCC(N)C1=NC(c2ccccc2)CO1 |
| InChI | InChI=1S/C12H16N2O/c1-2-10(13)12-14-11(8-15-12)9-6-4-3-5-7-9/h3-7,10-11H,2,8,13H2,1H3 |
| InChIKey | NQRXUSCBTDBYEO-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(4-phenyl-4,5-dihydro-1,3-oxazol-2-yl)propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-phenyl-4,5-dihydro-1,3-oxazol-2-yl)propan-1-amine?
The IUPAC name of 1-(4-phenyl-4,5-dihydro-1,3-oxazol-2-yl)propan-1-amine (CID 123654244) is 1-(4-phenyl-4,5-dihydro-1,3-oxazol-2-yl)propan-1-amine.
What is the SMILES notation for 1-(4-phenyl-4,5-dihydro-1,3-oxazol-2-yl)propan-1-amine?
The canonical SMILES for 1-(4-phenyl-4,5-dihydro-1,3-oxazol-2-yl)propan-1-amine is CCC(N)C1=NC(c2ccccc2)CO1.
What is the InChIKey of 1-(4-phenyl-4,5-dihydro-1,3-oxazol-2-yl)propan-1-amine?
The InChIKey is NQRXUSCBTDBYEO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N2O/c1-2-10(13)12-14-11(8-15-12)9-6-4-3-5-7-9/h3-7,10-11H,2,8,13H2,1H3.
What are the key properties of 1-(4-phenyl-4,5-dihydro-1,3-oxazol-2-yl)propan-1-amine?
1-(4-phenyl-4,5-dihydro-1,3-oxazol-2-yl)propan-1-amine has a molecular weight of 204.27 g/mol, XLogP of 1.89, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-phenyl-4,5-dihydro-1,3-oxazol-2-yl)propan-1-amine is sourced from PubChem (CID 123654244), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).