About 1-[(4-cyanophenyl)-(2,6-dioxocyclohexyl)methyl]-3-[4-(trifluoromethyl)-2-pyridinyl]urea
1-[(4-cyanophenyl)-(2,6-dioxocyclohexyl)methyl]-3-[4-(trifluoromethyl)-2-pyridinyl]urea (PubChem CID 123654351) has the molecular formula C21H17F3N4O3
and a molecular weight of 430.39 g/mol. Its IUPAC name is 1-[(4-cyanophenyl)-(2,6-dioxocyclohexyl)methyl]-3-[4-(trifluoromethyl)-2-pyridinyl]urea.
Molecular Properties
| Compound Name | 1-[(4-cyanophenyl)-(2,6-dioxocyclohexyl)methyl]-3-[4-(trifluoromethyl)-2-pyridinyl]urea |
| PubChem CID | 123654351 |
| Molecular Formula | C21H17F3N4O3 |
| Molecular Weight | 430.39 g/mol |
| Exact Mass | 430.13 |
| IUPAC Name | 1-[(4-cyanophenyl)-(2,6-dioxocyclohexyl)methyl]-3-[4-(trifluoromethyl)-2-pyridinyl]urea |
| SMILES | N#Cc1ccc(C(NC(=O)Nc2cc(C(F)(F)F)ccn2)C2C(=O)CCCC2=O)cc1 |
| InChI | InChI=1S/C21H17F3N4O3/c22-21(23,24)14-8-9-26-17(10-14)27-20(31)28-19(13-6-4-12(11-25)5-7-13)18-15(29)2-1-3-16(18)30/h4-10,18-19H,1-3H2,(H2,26,27,28,31) |
| InChIKey | ASNIUNSZAYHZTA-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 111.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 430.39 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 1-[(4-cyanophenyl)-(2,6-dioxocyclohexyl)methyl]-3-[4-(trifluoromethyl)-2-pyridinyl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(4-cyanophenyl)-(2,6-dioxocyclohexyl)methyl]-3-[4-(trifluoromethyl)-2-pyridinyl]urea?
The IUPAC name of 1-[(4-cyanophenyl)-(2,6-dioxocyclohexyl)methyl]-3-[4-(trifluoromethyl)-2-pyridinyl]urea (CID 123654351) is 1-[(4-cyanophenyl)-(2,6-dioxocyclohexyl)methyl]-3-[4-(trifluoromethyl)-2-pyridinyl]urea.
What is the SMILES notation for 1-[(4-cyanophenyl)-(2,6-dioxocyclohexyl)methyl]-3-[4-(trifluoromethyl)-2-pyridinyl]urea?
The canonical SMILES for 1-[(4-cyanophenyl)-(2,6-dioxocyclohexyl)methyl]-3-[4-(trifluoromethyl)-2-pyridinyl]urea is N#Cc1ccc(C(NC(=O)Nc2cc(C(F)(F)F)ccn2)C2C(=O)CCCC2=O)cc1.
What is the InChIKey of 1-[(4-cyanophenyl)-(2,6-dioxocyclohexyl)methyl]-3-[4-(trifluoromethyl)-2-pyridinyl]urea?
The InChIKey is ASNIUNSZAYHZTA-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H17F3N4O3/c22-21(23,24)14-8-9-26-17(10-14)27-20(31)28-19(13-6-4-12(11-25)5-7-13)18-15(29)2-1-3-16(18)30/h4-10,18-19H,1-3H2,(H2,26,27,28,31).
What are the key properties of 1-[(4-cyanophenyl)-(2,6-dioxocyclohexyl)methyl]-3-[4-(trifluoromethyl)-2-pyridinyl]urea?
1-[(4-cyanophenyl)-(2,6-dioxocyclohexyl)methyl]-3-[4-(trifluoromethyl)-2-pyridinyl]urea has a molecular weight of 430.39 g/mol, XLogP of 3.77, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(4-cyanophenyl)-(2,6-dioxocyclohexyl)methyl]-3-[4-(trifluoromethyl)-2-pyridinyl]urea is sourced from PubChem (CID 123654351), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).