About 3-(difluoromethyl)-5,6-diethyl-1H-pyridin-2-one
3-(difluoromethyl)-5,6-diethyl-1H-pyridin-2-one (PubChem CID 123654562) has the molecular formula C10H13F2NO
and a molecular weight of 201.22 g/mol. Its IUPAC name is 3-(difluoromethyl)-5,6-diethyl-1H-pyridin-2-one.
Molecular Properties
| Compound Name | 3-(difluoromethyl)-5,6-diethyl-1H-pyridin-2-one |
| PubChem CID | 123654562 |
| Molecular Formula | C10H13F2NO |
| Molecular Weight | 201.22 g/mol |
| Exact Mass | 201.10 |
| IUPAC Name | 3-(difluoromethyl)-5,6-diethyl-1H-pyridin-2-one |
| SMILES | CCc1cc(C(F)F)c(=O)[nH]c1CC |
| InChI | InChI=1S/C10H13F2NO/c1-3-6-5-7(9(11)12)10(14)13-8(6)4-2/h5,9H,3-4H2,1-2H3,(H,13,14) |
| InChIKey | MSPYFKNWZJHDQD-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.22 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-(difluoromethyl)-5,6-diethyl-1H-pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(difluoromethyl)-5,6-diethyl-1H-pyridin-2-one?
The IUPAC name of 3-(difluoromethyl)-5,6-diethyl-1H-pyridin-2-one (CID 123654562) is 3-(difluoromethyl)-5,6-diethyl-1H-pyridin-2-one.
What is the SMILES notation for 3-(difluoromethyl)-5,6-diethyl-1H-pyridin-2-one?
The canonical SMILES for 3-(difluoromethyl)-5,6-diethyl-1H-pyridin-2-one is CCc1cc(C(F)F)c(=O)[nH]c1CC.
What is the InChIKey of 3-(difluoromethyl)-5,6-diethyl-1H-pyridin-2-one?
The InChIKey is MSPYFKNWZJHDQD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13F2NO/c1-3-6-5-7(9(11)12)10(14)13-8(6)4-2/h5,9H,3-4H2,1-2H3,(H,13,14).
What are the key properties of 3-(difluoromethyl)-5,6-diethyl-1H-pyridin-2-one?
3-(difluoromethyl)-5,6-diethyl-1H-pyridin-2-one has a molecular weight of 201.22 g/mol, XLogP of 2.44, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(difluoromethyl)-5,6-diethyl-1H-pyridin-2-one is sourced from PubChem (CID 123654562), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).